![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[VID]](/icons/movie.gif) | 2% of vaccine reactions reported.mp4 | 2023-08-12 11:09 | 118M | |
| 3 Days that Stopped the World _ Al Jazeera Investigations.mp4 | 2021-01-22 00:21 | 1.3G | |
| 14,000 claims.mp4 | 2024-08-18 00:56 | 87M | |
| 15 million excess deaths.mp4 | 2022-05-07 12:45 | 187M | |
| 18 million excess deaths.mp4 | 2022-03-13 20:51 | 160M | |
| 29.2 times protection from vaccination.mp4 | 2021-08-30 04:30 | 284M | |
| 44% of hospitalisations boosted.mp4 | 2022-09-16 02:51 | 98M | |
| 77th Brigade in the pandemic.mp4 | 2023-01-30 20:20 | 106M | |
| 111 Doctors, Remote medicine.mp4 | 2021-05-05 22:46 | 180M | |
| 111 Doctors.mp4 | 2021-05-07 08:44 | 193M | |
| 140 million infections in US.mp4 | 2022-03-05 05:15 | 171M | |
| 2020 (A 1917 Parody).mp4 | 2020-11-29 15:29 | 244M | |
| 2024 White clot quantitative results.mp4 | 2024-12-21 18:43 | 103M | |
| 2024 White clot survey full report.mp4 | 2024-12-22 05:16 | 129M | |
| 2024 excess deaths.mp4 | 2024-07-04 20:36 | 73M | |
| Accelerated arterial disease.mp4 | 2024-05-01 17:57 | 162M | |
| A credible explanation behind vaccine adverse events, Marc Girardot.mp4 | 2023-03-17 20:20 | 752M | |
| Activated Vitamin D trial.mp4 | 2023-09-21 10:04 | 86M | |
| Adam (2).mp4 | 2024-01-25 16:52 | 472M | |
| Adam.mp4 | 2022-02-19 15:55 | 373M | |
| Adolescent hospitalizations increase.mp4 | 2021-06-09 05:56 | 187M | |
| Adverse reactions and under reporting.mp4 | 2023-07-19 12:02 | 41M | |
| Adverse vaccine events in 5 to 11 year olds.mp4 | 2022-07-23 09:13 | 92M | |
| Africa, better than US and UK.mp4 | 2021-11-08 14:04 | 305M | |
| Africa, low vaccination, covid over..mp4 | 2022-09-16 06:48 | 220M | |
| Africa, rapid increases.mp4 | 2021-07-14 04:44 | 140M | |
| After the vaccine.mp4 | 2024-02-13 20:32 | 534M | |
| After the vaccine_part1_2.mp4 | 2024-02-13 20:32 | 534M | |
| Alcohol, 120 million lost lives.mp4 | 2025-03-27 11:17 | 66M | |
| Alternative facts.mp4 | 2021-11-13 23:25 | 267M | |
| Amazing virology (fun clip).mp4 | 2021-12-31 21:50 | 85M | |
| A new dark age.mp4 | 2024-01-01 18:16 | 18M | |
| An injection of truth.mp4 | 2025-03-04 22:11 | 44M | |
| Antibodies in 99.3% of youth.mp4 | 2022-06-29 17:53 | 166M | |
| Antibody data and US predictions.mp4 | 2021-01-19 13:29 | 252M | |
| Antidepressant reduces hospitalisations and deaths.mp4 | 2021-10-31 11:40 | 240M | |
| Antigen survey shows high prevalence.mp4 | 2021-02-14 09:21 | 440M | |
| Anti scientific woke.mp4 | 2024-01-06 05:59 | 19M | |
| Antiviral game changer.mp4 | 2021-10-11 02:39 | 236M | |
| Apparent reinfections in Brazil.mp4 | 2021-02-14 01:50 | 272M | |
| April Canada Update.mp4 | 2021-04-22 19:17 | 189M | |
| Are drug regulators for hire_.mp4 | 2023-09-05 08:15 | 164M | |
| Are omicron vaccines needed.mp4 | 2022-02-04 19:54 | 139M | |
| Are you Prepared for the COVID Tsunami of Deaths_.mp4 | 2023-06-12 20:44 | 23M | |
| Arguments for and against boosters.mp4 | 2021-09-25 16:53 | 247M | |
| A sad day.mp4 | 2022-09-14 04:50 | 119M | |
| Asia, critical weeks.mp4 | 2021-06-27 22:07 | 291M | |
| Aspirate to vaccinate!.mp4 | 2021-04-17 16:30 | 244M | |
| Aspiration, more information.mp4 | 2021-10-10 23:38 | 207M | |
| Aspiration.mp4 | 2023-02-23 21:28 | 11M | |
| Asymptomatic spread.mp4 | 2023-12-29 12:17 | 125M | |
| A threatening phone call.mp4 | 2024-01-07 14:57 | 50M | |
| Australia Update_part1_2.mp4 | 2020-11-24 11:32 | 375M | |
| Australia and the world.mp4 | 2020-11-24 12:41 | 653M | |
| Australia lockdown.mp4 | 2021-06-26 20:29 | 342M | |
| Australian government biodistribution data.mp4 | 2023-03-24 22:28 | 50M | |
| Australia omicron and vaccinations.mp4 | 2021-12-04 08:02 | 53M | |
| Australia special report.mp4 | 2021-06-29 22:22 | 277M | |
| Australia update.mp4 | 2021-07-11 18:20 | 288M | |
| Australia update with Dr Farrier.mp4 | 2021-05-01 03:38 | 246M | |
| Autumn predictions and BBC checked.mp4 | 2021-11-13 23:44 | 212M | |
| Avoid the Semmelweis Reflex.mp4 | 2024-12-31 22:47 | 116M | |
| BA.4 increases with optimism.mp4 | 2022-06-16 03:25 | 117M | |
| BA.5 causes more severe disease.mp4 | 2022-07-05 17:52 | 197M | |
| BA 2 Omicron progresses.mp4 | 2022-02-13 06:05 | 273M | |
| BA 2 Omicron surge.mp4 | 2022-03-19 09:52 | 128M | |
| BMJ gets fact checked.mp4 | 2022-02-07 23:50 | 270M | |
| Barbados, Special report.mp4 | 2021-07-26 20:03 | 89M | |
| Beginning and end.mp4 | 2021-09-07 06:23 | 159M | |
| Best ivermectin meta analysis.mp4 | 2021-06-26 14:36 | 214M | |
| Best scientific documentary I've ever seen on Nano tech, Covid Vaccine deaths, fish out of water....mp4 | 2023-03-30 08:19 | 112M | |
| Big Pharma funds medical establishment.mp4 | 2023-07-28 00:31 | 164M | |
| Big UK debate.mp4 | 2021-07-12 04:25 | 202M | |
| Big US implications from Israel.mp4 | 2021-07-24 19:46 | 161M | |
| Bill Gates, Big Pharma and the Global War.mp4 | 2024-01-03 02:37 | 104M | |
| Bill Gates, pandemic book.mp4 | 2022-05-02 04:28 | 112M | |
| Bill Gates and Lessons from Africa.mp4 | 2022-03-31 22:57 | 256M | |
| Bill Gates and the High Priests.mp4 | 2023-12-31 06:17 | 21M | |
| BioNTech court case.mp4 | 2023-06-16 03:48 | 15M | |
| Bird flu in Cambodia.mp4 | 2023-02-28 20:11 | 190M | |
| Black fungus and effective vaccines.mp4 | 2021-05-25 06:15 | 261M | |
| Black fungus disease in India.mp4 | 2021-05-22 13:39 | 275M | |
| Booster doses effective.mp4 | 2021-09-04 05:58 | 207M | |
| Booster do work.mp4 | 2021-11-07 00:53 | 209M | |
| Boosters and antivirals.mp4 | 2021-11-08 11:51 | 73M | |
| Boosters for all adults, conflicting advice.mp4 | 2021-11-21 08:54 | 220M | |
| Boston gain of function virus.mp4 | 2022-10-22 22:42 | 184M | |
| Boston research.mp4 | 2023-04-17 08:14 | 99M | |
| Both UK vaccines working.mp4 | 2021-03-03 11:14 | 302M | |
| Boxing Day Pandemic Update.mp4 | 2020-12-26 20:41 | 122M | |
| Brazil, Special report.mp4 | 2021-04-07 04:23 | 131M | |
| Breast cancer prevention.mp4 | 2023-07-04 23:36 | 286M | |
| Brendan.mp4 | 2022-02-22 13:30 | 71M | |
| Brief global pandemic update.mp4 | 2022-03-04 15:11 | 41M | |
| British Heart Foundation release.mp4 | 2024-01-25 19:55 | 43M | |
| British regulators limit covid vaccines.mp4 | 2023-01-25 20:05 | 77M | |
| CDC, Vaccines from 6 months.mp4 | 2022-06-20 02:55 | 179M | |
| CDC, increased infection risk in vaccinated.mp4 | 2023-08-29 09:09 | 131M | |
| CDC, natural immunity not mentioned.mp4 | 2022-11-27 12:51 | 68M | |
| CDC changes it's mind.mp4 | 2021-07-29 07:46 | 373M | |
| CDC comes up to date.mp4 | 2021-05-12 22:33 | 174M | |
| CDC leak, summary and full report.mp4 | 2021-08-01 19:15 | 306M | |
| CDC pushes childhood vaccination.mp4 | 2022-06-15 02:22 | 245M | |
| COVID, Immunity probably long lasting.mp4 | 2020-11-02 04:50 | 301M | |
| COVID, Infection Fatality Rates.mp4 | 2020-10-19 22:57 | 305M | |
| COVID-19 and Zinc.mp4 | 2020-10-16 07:45 | 218M | |
| COVID Mutation Spreads.mp4 | 2020-12-22 05:31 | 196M | |
| COVID Psychological Manipulation_ Unpacked.mp4 | 2024-02-15 09:57 | 1.2G | |
| COVID Vaccine Update.mp4 | 2020-11-16 00:29 | 199M | |
| COVID cases increase and new variant.mp4 | 2020-12-24 05:14 | 301M | |
| COVID long haulers update.mp4 | 2020-11-29 17:44 | 200M | |
| COVID risk factors and implications.mp4 | 2020-11-01 19:32 | 270M | |
| Can I catch omicron twice_.mp4 | 2022-02-25 08:16 | 40M | |
| Canada, National Citizens Inquiry.mp4 | 2023-09-21 17:52 | 72M | |
| Canada Update_part1_2.mp4 | 2021-03-06 04:13 | 197M | |
| Canada update.mp4 | 2021-07-04 09:00 | 216M | |
| Canadian Citizens Inquiry.mp4 | 2023-12-14 10:37 | 232M | |
| Canadian Pandemic with Lindsay.mp4 | 2020-12-13 01:49 | 111M | |
| Canadian heat stroke.mp4 | 2021-07-04 11:36 | 241M | |
| Cancer, early warning signs.mp4 | 2022-11-24 11:38 | 159M | |
| Cancer reactivation.mp4 | 2023-10-08 06:13 | 61M | |
| Cancers in the young.mp4 | 2025-03-30 18:53 | 174M | |
| Care home deaths.mp4 | 2023-11-03 09:01 | 218M | |
| Cases and deaths surge in Brazil.mp4 | 2021-03-28 22:44 | 209M | |
| Cases declining rapidly.mp4 | 2022-02-16 03:39 | 150M | |
| Cases down, long covid concerns.mp4 | 2022-05-09 02:47 | 104M | |
| Cases down in UK and US.mp4 | 2021-02-09 21:11 | 323M | |
| Cases rise, new variant in US.mp4 | 2020-12-31 23:36 | 299M | |
| Cause of myocarditis.mp4 | 2023-08-06 19:30 | 90M | |
| Cecelia at New Hope Children's Centre, Kenya.mp4 | 2022-09-11 05:49 | 64M | |
| Censorship.mp4 | 2024-08-29 10:48 | 120M | |
| Change in death stats.mp4 | 2024-02-23 07:14 | 82M | |
| Change in symptoms.mp4 | 2021-06-11 04:51 | 181M | |
| Changing symptoms.mp4 | 2021-06-26 17:59 | 149M | |
| Changing views.mp4 | 2024-10-10 03:55 | 176M | |
| Child deaths from Group A Strep.mp4 | 2022-12-08 10:02 | 172M | |
| Child excess deaths, 8%.mp4 | 2024-01-17 07:01 | 37M | |
| Childhood hepatitis outbreaks.mp4 | 2022-04-18 16:17 | 211M | |
| Childhood viral hepatitis – Vulnerabilities and the Chickenpox (Varicella) Vaccine.mp4 | 2022-10-11 11:43 | 229M | |
| Chile, Special report.mp4 | 2021-07-16 22:22 | 94M | |
| China, mass infections.mp4 | 2023-01-04 04:25 | 143M | |
| China, tens of millions infected.mp4 | 2022-12-29 20:54 | 224M | |
| China, zero covid.mp4 | 2022-01-24 00:35 | 151M | |
| Chinese Virologist Who Claimed Covid Lab Made Releases Second Paper.mp4 | 2021-01-03 16:03 | 20M | |
| Chinese massive spread.mp4 | 2022-12-15 18:24 | 201M | |
| Chinese vaccine comparisons.mp4 | 2022-12-11 21:21 | 154M | |
| Cholera, important lessons for today.mp4 | 2024-12-29 05:42 | 61M | |
| Chronic inflammation and cancer.mp4 | 2024-01-19 15:26 | 405M | |
| Clinical immunology in the Covid era.mp4 | 2022-06-19 07:31 | 322M | |
| Clip, Moderna expands, UK, Canada and Australia plants.mp4 | 2022-12-26 16:34 | 61M | |
| Close contact spread.mp4 | 2023-11-27 00:28 | 60M | |
| CoViD Symptoms.mp4 | 2021-03-20 22:35 | 237M | |
| Combined community health project.mp4 | 2021-12-27 06:48 | 109M | |
| Common deficiency and dementia.mp4 | 2023-07-25 10:04 | 50M | |
| Comorbid diseases.mp4 | 2021-05-22 07:27 | 275M | |
| Comparative immunity update.mp4 | 2021-11-01 12:57 | 213M | |
| Compared vaccine adverse effects.mp4 | 2021-04-16 12:53 | 217M | |
| Concerns.mp4 | 2024-05-14 10:40 | 143M | |
| Concerns from Vietnam.mp4 | 2021-05-31 20:42 | 209M | |
| Confirmation of fears.mp4 | 2024-06-13 02:42 | 46M | |
| Confirmed horrifying scandal.mp4 | 2024-05-20 19:20 | 167M | |
| Conspiracy theories.mp4 | 2025-04-07 18:53 | 308M | |
| Convalescent Plasma, Poor results.mp4 | 2020-10-26 06:24 | 263M | |
| Convalescent plasma, no benefit.mp4 | 2021-01-18 15:26 | 357M | |
| Coronavirus survival.mp4 | 2020-10-14 00:56 | 32M | |
| Counter Disinformation Unit.mp4 | 2023-06-04 13:23 | 191M | |
| Covert Genetically Modified Organisms.mp4 | 2024-05-07 03:09 | 183M | |
| Covert Genetically Modified Organisms_part1_2.mp4 | 2024-05-07 21:41 | 209M | |
| Covert psychological manipulation.mp4 | 2024-01-07 10:35 | 18M | |
| Covid, consistent symptoms.mp4 | 2022-10-13 13:08 | 117M | |
| Covid, vaccines, malaria.mp4 | 2022-10-29 03:01 | 118M | |
| Covid 5 year review.mp4 | 2025-02-15 04:54 | 510M | |
| Covid Inquiry appears fundamentally biased.mp4 | 2024-03-14 08:22 | 88M | |
| Covid and pregnancy.mp4 | 2020-11-06 01:09 | 145M | |
| Covid autoimmunity.mp4 | 2021-10-31 20:38 | 207M | |
| Covid booster jabs for all.mp4 | 2023-09-15 08:01 | 150M | |
| Covid bounce back.mp4 | 2021-09-07 02:57 | 160M | |
| Covid causing diabetes.mp4 | 2021-08-15 04:43 | 408M | |
| Covid could have started earlier than thought.mp4 | 2022-11-03 02:50 | 197M | |
| Covid deaths down 90% this year.mp4 | 2022-11-13 20:12 | 136M | |
| Covid endemic update.mp4 | 2022-10-30 13:35 | 129M | |
| Covid era deaths, Dr. Clare Craig.mp4 | 2024-11-10 19:34 | 121M | |
| Covid infection increases still births.mp4 | 2021-11-27 14:07 | 272M | |
| Covid infections increasing again.mp4 | 2022-09-24 23:18 | 119M | |
| Covid inquire no go zone.mp4 | 2024-01-21 23:58 | 24M | |
| Covid natural immunity confirmed.mp4 | 2023-02-26 16:50 | 166M | |
| Covid optimism.mp4 | 2022-08-07 12:40 | 167M | |
| Covid symptoms change.mp4 | 2022-08-26 22:10 | 152M | |
| Covid vaccine and road accidents.mp4 | 2022-12-18 01:18 | 79M | |
| Covid vaccines are safe.mp4 | 2024-02-04 14:03 | 101M | |
| Critical care units full.mp4 | 2022-03-03 22:58 | 237M | |
| Croatia, special report.mp4 | 2020-12-12 18:58 | 313M | |
| Current covid cold symptoms.mp4 | 2023-01-17 10:03 | 91M | |
| Current state of COVID knowledge.mp4 | 2020-11-29 21:28 | 322M | |
| Current symptoms and data.mp4 | 2022-10-10 22:19 | 119M | |
| Czech Republic, Special report.mp4 | 2020-10-26 09:45 | 87M | |
| Czech Republic, Special report part 2.mp4 | 2020-10-26 08:20 | 44M | |
| Czech republic authorises ivermectin.mp4 | 2021-03-08 16:40 | 212M | |
| DNA.mp4 | 2024-05-01 18:11 | 244M | |
| DNA and Florida.mp4 | 2024-01-10 12:17 | 71M | |
| DW Interview , Global cases and Russian vaccine.mp4 | 2020-08-11 18:04 | 59M | |
| DW News Interview.mp4 | 2020-11-30 07:55 | 85M | |
| DW Omicron interview.mp4 | 2021-12-18 15:09 | 41M | |
| DW interview.mp4 | 2021-06-29 00:44 | 51M | |
| DW news interview, Omicron latest.mp4 | 2021-11-27 13:45 | 41M | |
| Data, we want it all, and we want it now.mp4 | 2022-01-29 04:30 | 178M | |
| Data on reinfections.mp4 | 2021-07-05 23:13 | 287M | |
| Daughter of omicron.mp4 | 2022-01-27 16:43 | 187M | |
| Daughter of omicron sound corrected.mp4 | 2022-01-28 04:04 | 101M | |
| Davos or parliament.mp4 | 2024-01-09 07:49 | 21M | |
| Death certificate problems.mp4 | 2023-12-08 02:51 | 13M | |
| Death of science and covid.mp4 | 2024-01-01 18:24 | 26M | |
| Deaths WITH covid increase.mp4 | 2022-03-01 17:17 | 145M | |
| Debunking the BBC debunk of ivermectin.mp4 | 2021-10-10 22:53 | 280M | |
| Decisions, overwhelmingly wrong.mp4 | 2024-01-25 00:56 | 12M | |
| Declining vaccine efficacy.mp4 | 2021-10-25 10:07 | 141M | |
| Defining fever.mp4 | 2021-02-08 19:43 | 293M | |
| Delta (india) variant increases in UK and US.mp4 | 2021-06-09 18:57 | 252M | |
| Delta, 60% more infectious.mp4 | 2021-06-13 14:15 | 166M | |
| Delta, double hospital risk.mp4 | 2021-08-30 01:27 | 247M | |
| Delta Plus, cause for concern_.mp4 | 2021-10-21 09:56 | 212M | |
| Delta and children.mp4 | 2021-08-14 23:02 | 147M | |
| Deltacron.mp4 | 2022-01-10 08:56 | 109M | |
| Delta goes to Europe.mp4 | 2021-06-26 15:56 | 164M | |
| Delta pandemic.mp4 | 2021-08-16 00:22 | 173M | |
| Delta pandemic_part1_2.mp4 | 2021-06-30 21:40 | 223M | |
| Delta plus and long covid.mp4 | 2021-09-04 19:23 | 80M | |
| Delta up to 99%.mp4 | 2021-06-19 18:51 | 269M | |
| Delta variant.mp4 | 2021-06-29 02:57 | 48M | |
| Delta variant more dangerous.mp4 | 2021-06-16 03:27 | 306M | |
| Delta variant spreads from UK.mp4 | 2021-06-29 05:19 | 24M | |
| Dementia.mp4 | 2024-07-22 13:53 | 38M | |
| Dementia awareness.mp4 | 2024-06-28 21:58 | 72M | |
| Denmark ends pandemic.mp4 | 2022-02-04 01:30 | 114M | |
| Depression, I was wrong.mp4 | 2022-08-15 19:03 | 145M | |
| Depression, high levels.mp4 | 2023-11-22 17:28 | 211M | |
| Depression and over medication.mp4 | 2023-02-24 07:36 | 379M | |
| Detailed vaccine safety update.mp4 | 2021-03-20 00:07 | 261M | |
| Detroit at risk..mp4 | 2021-08-01 17:12 | 400M | |
| Diet, gut microbiome and health.mp4 | 2022-06-07 07:01 | 105M | |
| Difficult COVID month ahead.mp4 | 2021-01-18 18:14 | 320M | |
| Difficult watch from Uganda.mp4 | 2022-08-06 02:40 | 195M | |
| Disaster in North Korea.mp4 | 2022-05-18 03:27 | 192M | |
| Discussions with pulmonologist working in India.mp4 | 2022-02-05 20:53 | 263M | |
| Discussion with Russell Brand.mp4 | 2023-03-12 08:14 | 148M | |
| Disease X.mp4 | 2024-01-14 05:57 | 89M | |
| Doctor goes public.mp4 | 2024-12-11 13:57 | 283M | |
| Does the Covid Vaccine INCREASE the Risk of Infection_.mp4 | 2023-06-20 14:38 | 25M | |
| Double warning.mp4 | 2023-10-16 08:03 | 243M | |
| Do viruses want to kill people.mp4 | 2023-12-18 09:41 | 27M | |
| Dr. Tess Lawrie on WHO power.mp4 | 2023-12-17 10:51 | 327M | |
| Dr Cohen and iron.mp4 | 2021-12-27 16:05 | 279M | |
| Dr Cohen on family medicine.mp4 | 2021-12-22 05:34 | 712M | |
| Dr Craig, pathologist, part 2.mp4 | 2023-12-06 16:50 | 633M | |
| Dr Jones and the Counter Disinformation Unit.mp4 | 2023-06-05 23:00 | 129M | |
| Dr Lawrie, Ivermectin video, Short Precis.mp4 | 2021-03-08 04:42 | 210M | |
| Dr Lisa Fitzpatrick, Community health promotion, Washington DC.mp4 | 2022-02-22 16:50 | 518M | |
| Dr Lisa Fitzpatrick in Washington DC.mp4 | 2021-03-28 15:26 | 471M | |
| Dr Manniche and John are abused.mp4 | 2023-07-15 06:03 | 234M | |
| Dr Nair, India, Summary.mp4 | 2021-05-02 06:28 | 176M | |
| Dr Nair, Infectious Diseases Consultant, India.mp4 | 2021-05-02 02:00 | 122M | |
| Encouraging Israeli vaccine data.mp4 | 2021-02-19 22:07 | 322M | |
| Encouraging high infection rate.mp4 | 2022-04-24 17:38 | 175M | |
| Encouraging movement.mp4 | 2024-05-05 08:48 | 52M | |
| Endemic equilibrium cometh.mp4 | 2021-10-31 17:43 | 344M | |
| England, Step two opening.mp4 | 2021-04-12 11:22 | 102M | |
| England plans for lifting restrictions.mp4 | 2021-02-22 17:54 | 65M | |
| Europe, BA 5 and monkeypox next.mp4 | 2022-05-21 15:37 | 177M | |
| European concern.mp4 | 2023-05-26 12:19 | 52M | |
| European excess deaths, official data.mp4 | 2023-01-24 16:06 | 91M | |
| European excess deaths.mp4 | 2023-07-14 17:21 | 150M | |
| European normalisation.mp4 | 2022-02-06 23:27 | 226M | |
| European risk.mp4 | 2023-05-31 18:32 | 133M | |
| Europe eventually follows AZ evidence.mp4 | 2021-03-06 01:49 | 190M | |
| Euthanasia in the pandemic_.mp4 | 2023-02-13 19:24 | 119M | |
| Every home diagnostic devices.mp4 | 2022-10-01 12:46 | 97M | |
| Everyone was suceptible.mp4 | 2023-11-26 22:21 | 61M | |
| Evidence based communication.mp4 | 2024-06-19 20:33 | 67M | |
| Evidence based practice, Dr Tess Lawrie.mp4 | 2021-03-06 16:26 | 36M | |
| Evidence on covid restrictions is back.mp4 | 2023-06-08 10:40 | 56M | |
| Excellent natural immunity confirmed.mp4 | 2022-01-28 07:09 | 258M | |
| Excellent vaccine news.mp4 | 2020-12-20 01:23 | 303M | |
| Excellent vaccine results, takes time.mp4 | 2021-02-28 06:55 | 233M | |
| Excess baby deaths investigation.mp4 | 2022-10-20 02:56 | 134M | |
| Excess death debate.mp4 | 2024-07-28 16:35 | 142M | |
| Excess deaths, MP calls for urgent and thorough investigation.mp4 | 2023-02-09 16:39 | 121M | |
| Excess deaths, MPs request data.mp4 | 2024-07-28 16:35 | 103M | |
| Excess deaths, lack of data.mp4 | 2022-11-24 20:24 | 115M | |
| Excess deaths, lack of debate.mp4 | 2023-07-23 11:27 | 102M | |
| Excess deaths, mixed news, lack of data.mp4 | 2022-11-30 00:25 | 92M | |
| Excess deaths, parliament questions.mp4 | 2023-03-21 00:32 | 79M | |
| Excess deaths, the data.mp4 | 2022-10-16 12:29 | 113M | |
| Excess deaths, the silence.mp4 | 2023-07-17 02:14 | 427M | |
| Excess deaths.mp4 | 2021-04-05 13:11 | 183M | |
| Excess deaths continue.mp4 | 2022-11-06 01:40 | 118M | |
| Excess deaths debate 16 January.mp4 | 2024-07-28 16:35 | 249M | |
| Excess deaths debate in parliament.mp4 | 2023-09-30 17:30 | 90M | |
| Excess deaths discussion.mp4 | 2023-02-25 16:54 | 204M | |
| Excess deaths in 30 countries.mp4 | 2023-01-26 20:44 | 116M | |
| Excess deaths in 2023.mp4 | 2024-07-28 16:35 | 70M | |
| Excess deaths in 2023_part1_2.mp4 | 2024-07-28 16:35 | 112M | |
| Excess deaths in 2023 confirmed.mp4 | 2023-09-24 16:31 | 139M | |
| Excess deaths in all age groups.mp4 | 2023-01-10 23:59 | 114M | |
| Excess deaths in young adults, 2022 data.mp4 | 2023-01-22 22:23 | 134M | |
| Excess deaths in young adults.mp4 | 2025-02-11 05:26 | 114M | |
| Excess deaths persist.mp4 | 2023-08-11 17:12 | 36M | |
| Excess deaths published.mp4 | 2024-11-13 16:28 | 162M | |
| Excess deaths with Senator Rennick.mp4 | 2023-07-18 05:57 | 319M | |
| Excess heart deaths.mp4 | 2023-07-08 17:08 | 144M | |
| Excess long term sickness.mp4 | 2022-12-13 16:17 | 131M | |
| Excess young deaths, UK and US.mp4 | 2022-10-27 20:00 | 121M | |
| Expensive treatment in US.mp4 | 2021-08-17 04:56 | 270M | |
| Expensive vaccinations for the young.mp4 | 2021-08-05 18:49 | 195M | |
| Expired with Dr. Clare Craig.mp4 | 2024-07-28 16:37 | 712M | |
| FDA and ivermectin.mp4 | 2023-08-20 19:49 | 67M | |
| FDA approves BA. 5 vaccine.mp4 | 2022-09-11 04:32 | 99M | |
| FDA full approval for Pfizer.mp4 | 2021-09-07 00:01 | 193M | |
| Fact checking the don't knows.mp4 | 2023-06-09 12:17 | 114M | |
| Falsified or concealed data.mp4 | 2024-07-28 16:38 | 53M | |
| Famine in 2022.mp4 | 2022-06-11 22:27 | 109M | |
| Fauci preemptive pardon.mp4 | 2024-12-08 12:37 | 66M | |
| Fetal development.mp4 | 2022-06-28 01:29 | 97M | |
| Fever, Fluids, Food in acute infections.mp4 | 2021-12-25 05:26 | 352M | |
| Fevers, good or bad.mp4 | 2021-01-15 19:39 | 208M | |
| First High Court case.mp4 | 2024-07-28 16:38 | 156M | |
| First Omicron science.mp4 | 2021-12-19 14:23 | 208M | |
| First Vaccine approved in UK.mp4 | 2020-12-03 00:06 | 436M | |
| First dose COVID vaccination.mp4 | 2021-01-01 08:07 | 39M | |
| First peer-reviewed vaccine evidence.mp4 | 2020-12-20 02:01 | 306M | |
| First viral human challenge study.mp4 | 2020-10-26 03:28 | 305M | |
| Florida, no childhood vaccinations.mp4 | 2022-03-12 05:58 | 204M | |
| Florida and Texas worst, UK antibodies high.mp4 | 2021-08-07 06:49 | 306M | |
| Florida changes vaccine advice for young men.mp4 | 2022-10-11 22:20 | 147M | |
| Fourth vaccine dose.mp4 | 2022-04-06 18:11 | 206M | |
| Freedom of information discussion.mp4 | 2022-01-22 05:41 | 154M | |
| Freedom of speech.mp4 | 2023-07-29 22:47 | 114M | |
| Free speech and future dystopia.mp4 | 2024-12-19 00:59 | 40M | |
| French Virologist, Who Discovered HIV, Says Coronavirus Originated In A Lab.webm | 2021-01-05 12:51 | 17M | |
| Full analysis, vaccines and accidents.mp4 | 2022-12-18 18:21 | 264M | |
| G20 and the next pandemic.mp4 | 2022-11-23 14:28 | 105M | |
| Gain of function research.mp4 | 2023-03-20 02:31 | 249M | |
| Gates foundation funding.mp4 | 2024-07-28 17:14 | 101M | |
| Genetics and covid deaths.mp4 | 2022-06-12 08:25 | 236M | |
| Gibraltar, vaccine failure.mp4 | 2021-11-27 06:49 | 221M | |
| Gibraltar Pandemic Achievements.mp4 | 2021-11-27 22:12 | 570M | |
| Give thanks COVID safely.mp4 | 2020-11-29 14:40 | 246M | |
| Giving injections wrongly.mp4 | 2021-11-06 23:43 | 138M | |
| Global WHO digital health certification.mp4 | 2023-08-10 05:32 | 51M | |
| Global and Australian update.mp4 | 2022-03-16 19:27 | 99M | |
| Global cases increase in March.mp4 | 2021-03-26 00:35 | 306M | |
| Global childhood deaths will increase.mp4 | 2022-07-27 10:10 | 134M | |
| Global deaths rankings.mp4 | 2022-12-01 16:47 | 101M | |
| Global deaths under-reported.mp4 | 2021-11-06 23:56 | 141M | |
| Global deaths underestimated.mp4 | 2021-05-09 21:12 | 270M | |
| Global differences.mp4 | 2021-09-25 18:44 | 156M | |
| Global disinformation.mp4 | 2021-05-28 00:32 | 122M | |
| Global excess deaths.mp4 | 2024-08-10 07:00 | 60M | |
| Global public good.mp4 | 2023-06-08 17:31 | 91M | |
| Global update, mandated vaccination.mp4 | 2021-07-17 19:25 | 251M | |
| Goa, ivermectin for all adults.mp4 | 2021-05-14 00:05 | 239M | |
| Good Friday update.mp4 | 2021-04-02 15:43 | 210M | |
| Good fortune with omicron.mp4 | 2022-03-27 21:34 | 223M | |
| Good long term immunity.mp4 | 2021-06-01 01:58 | 309M | |
| Good morning.mp4 | 2024-09-06 05:54 | 123M | |
| Good natural immunity data.mp4 | 2022-07-24 05:49 | 132M | |
| Good news, BA 2 milder than BA 1.mp4 | 2022-05-15 05:43 | 208M | |
| Good news at Easter.mp4 | 2022-04-16 11:38 | 129M | |
| Good vaccine news in US.mp4 | 2021-03-25 23:07 | 161M | |
| Great news from Africa.mp4 | 2022-01-29 19:32 | 246M | |
| Great public support.mp4 | 2024-07-28 17:15 | 13M | |
| Great questions on depression.mp4 | 2022-08-21 08:05 | 65M | |
| Great talk with GB News and Bev Turner.mp4 | 2022-11-22 17:30 | 65M | |
| Great wide ranging talk with Russell Brand.mp4 | 2022-02-26 21:41 | 171M | |
| Groundbreaking antibody research in UK.mp4 | 2021-08-27 16:34 | 455M | |
| Hands, face, space AND Ventilate.mp4 | 2020-11-15 15:06 | 142M | |
| Harms to children.mp4 | 2024-07-28 17:16 | 27M | |
| Health care provision in a pandemic.mp4 | 2021-01-09 03:46 | 189M | |
| Heart deaths.mp4 | 2024-07-28 17:17 | 214M | |
| Heart deaths in Australia.mp4 | 2023-06-16 01:25 | 19M | |
| Heart disease press release.mp4 | 2024-07-28 17:17 | 149M | |
| Heart disease with Dr. Aseem Malhotra.mp4 | 2022-10-29 04:03 | 215M | |
| Heart inflammation in Israel.mp4 | 2021-04-27 20:49 | 272M | |
| Heart risk after vaccines.mp4 | 2021-11-27 08:57 | 252M | |
| Heat stroke.mp4 | 2022-07-16 20:22 | 185M | |
| Helsinki.mp4 | 2024-07-28 17:17 | 149M | |
| He who pays the modeler.mp4 | 2024-07-28 17:16 | 29M | |
| High US positive test rates.mp4 | 2020-11-19 05:34 | 325M | |
| High death numbers in India.mp4 | 2021-04-21 02:55 | 220M | |
| High disabled and LD deaths.mp4 | 2021-02-18 05:22 | 333M | |
| Highest deaths since 1929.mp4 | 2022-05-28 02:57 | 137M | |
| High excess deaths in Australia.mp4 | 2022-10-16 18:12 | 90M | |
| Highly contagious omicron in New York.mp4 | 2022-04-17 05:31 | 129M | |
| High quality epidemiology.mp4 | 2021-09-20 12:24 | 93M | |
| Historic Pandemic.mp4 | 2020-11-06 18:41 | 215M | |
| Home ivermectin based kits in India.mp4 | 2021-09-25 10:03 | 200M | |
| Hope accord in detail.mp4 | 2024-07-06 05:54 | 185M | |
| Hope update.mp4 | 2024-09-13 03:03 | 46M | |
| Hospitalisations and new varients.mp4 | 2021-01-21 04:08 | 295M | |
| Hospitals to stop testing for asymptomatic admissions.mp4 | 2022-08-27 10:25 | 118M | |
| House Oversight in US.mp4 | 2024-07-28 17:18 | 93M | |
| How did the pandemic start_.mp4 | 2021-03-29 19:56 | 203M | |
| How to investigate excess deaths (clip).mp4 | 2023-01-15 05:39 | 63M | |
| Human Challenge studies.mp4 | 2021-02-19 12:51 | 366M | |
| Human Rights.mp4 | 2024-07-08 07:44 | 105M | |
| Human fertility.mp4 | 2024-07-28 17:20 | 132M | |
| Hydroxychloroquine as a therapeutic.mp4 | 2020-11-11 09:08 | 220M | |
| Idaho crisis, Ivermectin clarification.mp4 | 2021-09-20 07:48 | 169M | |
| Ignored excess deaths.mp4 | 2024-07-28 17:22 | 45M | |
| Immunity, history and understanding.mp4 | 2022-08-18 01:14 | 675M | |
| Immunology, the cellular era.mp4 | 2023-03-21 19:31 | 518M | |
| Immunology, the modern era.mp4 | 2023-04-05 10:34 | 498M | |
| Immunology, the molecular era.mp4 | 2023-03-24 07:30 | 573M | |
| Immunology of mRNA vaccines.mp4 | 2023-01-14 21:40 | 210M | |
| Immunology with Professor Robert Clancy.mp4 | 2022-01-24 01:01 | 115M | |
| Importance of human life.mp4 | 2023-08-13 08:26 | 130M | |
| Important Long Covid information.mp4 | 2021-07-24 14:44 | 467M | |
| Important UK vaccine announcment.mp4 | 2021-11-21 12:07 | 277M | |
| Important announcement.mp4 | 2021-09-07 03:11 | 161M | |
| Important public letter.mp4 | 2024-12-12 07:21 | 364M | |
| Important scientific information with Dr. Pieter Gaillard and John.mp4 | 2021-10-25 12:52 | 148M | |
| Inadvertant intravenous injections.mp4 | 2021-09-27 03:46 | 246M | |
| Inconsistencies in official numbers.mp4 | 2021-10-31 20:14 | 202M | |
| Inconsistent vaccination data.mp4 | 2022-10-18 10:51 | 129M | |
| Increased deaths in the US.mp4 | 2021-09-20 05:05 | 99M | |
| Increased risk of stroke.mp4 | 2023-01-19 19:03 | 150M | |
| Increases.mp4 | 2024-07-28 17:22 | 35M | |
| Increasing antibody prevalence.mp4 | 2021-05-20 13:45 | 191M | |
| Independence Day and long covid.mp4 | 2021-07-10 17:45 | 200M | |
| India, US and Liverpool.mp4 | 2021-05-05 12:21 | 210M | |
| India, infections reduce.mp4 | 2021-06-18 07:19 | 221M | |
| India needs US vaccine ingredients.mp4 | 2021-04-24 23:33 | 417M | |
| Indian variant now in US.mp4 | 2021-05-04 14:06 | 327M | |
| India variant increases in UK.mp4 | 2021-05-05 20:34 | 204M | |
| India variant more transmissible.mp4 | 2021-05-16 00:19 | 223M | |
| India variant officially recognised in UK.mp4 | 2021-05-08 22:54 | 199M | |
| Infection and immunity, Professor Clancy.mp4 | 2022-07-15 13:11 | 172M | |
| Infection generates natural immunity.mp4 | 2022-02-17 02:19 | 240M | |
| Infections, high but declining.mp4 | 2022-08-02 05:40 | 133M | |
| Infections, transatlantic surge.mp4 | 2022-07-13 01:21 | 241M | |
| Infections and deaths after vaccination.mp4 | 2021-04-17 12:43 | 240M | |
| Infections increasing globally.mp4 | 2021-04-21 20:28 | 258M | |
| Infections in many poorer countries.mp4 | 2021-07-11 00:28 | 157M | |
| Inflammation.mp4 | 2024-07-28 17:23 | 34M | |
| Inflammation and mast cell activation syndrome.mp4 | 2024-06-25 21:01 | 171M | |
| Inflammatory Syndrome in Children.mp4 | 2022-02-25 09:28 | 183M | |
| Informed Consent for 4th dose.mp4 | 2022-04-10 11:38 | 240M | |
| Injections in Denmark.mp4 | 2021-03-25 23:50 | 134M | |
| Injections versus infections, Pandemic update.mp4 | 2020-12-28 14:08 | 286M | |
| Interactions of health.mp4 | 2022-01-07 16:34 | 168M | |
| Interesting long form interview with Neil Oliver.mp4 | 2023-01-20 23:05 | 872M | |
| Intermittent fasting with Tim and John.mp4 | 2022-10-20 12:57 | 323M | |
| International BA 5 wave.mp4 | 2022-06-28 00:34 | 202M | |
| International Health Regulations.mp4 | 2023-05-26 07:40 | 133M | |
| International Update.mp4 | 2021-03-19 21:12 | 267M | |
| International concern, excess deaths.mp4 | 2023-02-11 17:23 | 128M | |
| International critique.mp4 | 2022-03-25 00:58 | 217M | |
| International data agrees.mp4 | 2022-01-12 21:57 | 228M | |
| International excess deaths.mp4 | 2023-06-11 15:46 | 23M | |
| International omicron doubling.mp4 | 2021-12-11 16:14 | 247M | |
| International scandal.mp4 | 2025-04-18 14:54 | 222M | |
| International situation.mp4 | 2024-07-28 17:24 | 77M | |
| International travel and increasing cases.mp4 | 2021-01-17 20:35 | 74M | |
| International trends.mp4 | 2021-02-27 14:11 | 140M | |
| International vaccine implications.mp4 | 2021-06-03 06:14 | 256M | |
| International vaccine safety concerns.mp4 | 2021-03-15 19:11 | 227M | |
| Interview, correction, qualification.mp4 | 2021-11-27 10:26 | 49M | |
| Interview, vaccines and acceptance.mp4 | 2020-11-17 12:21 | 99M | |
| Interview, variants, Ireland, ivermectin.mp4 | 2021-05-17 02:50 | 61M | |
| Interview on UK.mp4 | 2020-10-28 05:30 | 39M | |
| Interview on the NHS in the UK.mp4 | 2021-09-07 01:07 | 69M | |
| Intresting interview with Afshin.mp4 | 2021-12-09 09:05 | 128M | |
| Ireland, vitamin D report.mp4 | 2021-04-08 05:53 | 318M | |
| Ireland and transatlantic differences.mp4 | 2021-01-10 01:21 | 269M | |
| Ireland special report.mp4 | 2021-07-06 19:57 | 260M | |
| Is Evidence Based Medicine now impossible_.mp4 | 2024-07-28 17:25 | 132M | |
| Is global vaccination still required_.mp4 | 2022-04-30 11:48 | 149M | |
| Is it Possible that the Covid ____ could be Linked to Cancer_.mp4 | 2024-07-28 17:25 | 85M | |
| Is new omicron more severe_.mp4 | 2022-02-25 17:28 | 74M | |
| Israel, waning transmission protection.mp4 | 2021-07-24 05:09 | 148M | |
| Israel special report.mp4 | 2021-01-10 06:10 | 173M | |
| Italy, September 2019.mp4 | 2022-11-05 00:12 | 169M | |
| Ivermectin, Mexico, Peru, India.mp4 | 2021-06-02 02:57 | 206M | |
| Ivermectin Evidence with Dr Tess Lawrie.mp4 | 2021-03-07 05:20 | 179M | |
| Ivermectin advised for India.mp4 | 2021-05-13 04:34 | 268M | |
| Ivermectin and COVID 19.mp4 | 2020-12-24 00:10 | 145M | |
| Ivermectin and vaccine injury.mp4 | 2024-07-28 17:26 | 336M | |
| Ivermectin clarification.mp4 | 2022-10-06 21:01 | 127M | |
| Ivermectin discussion with Dr Tess Lawrie.mp4 | 2022-07-23 03:34 | 111M | |
| Ivermectin in Africa and Brazil.mp4 | 2022-03-14 09:32 | 96M | |
| Ivermectin in Australia.mp4 | 2021-09-21 09:18 | 215M | |
| Ivermectin in Japan.mp4 | 2021-11-30 12:53 | 151M | |
| Ivermectin in Oklahoma.mp4 | 2022-02-15 21:31 | 151M | |
| Ivermectin or Molnupiravir.mp4 | 2021-10-10 20:21 | 406M | |
| Ivermectin prophylactic study from India.mp4 | 2021-05-29 10:57 | 155M | |
| Ivermectin trial, Oxford University.mp4 | 2022-02-10 00:21 | 109M | |
| Japan data.mp4 | 2024-07-28 17:26 | 105M | |
| Japan pathology.mp4 | 2023-04-11 17:38 | 153M | |
| John and Neil.mp4 | 2024-07-28 17:28 | 58M | |
| John gets 'fact checked'.mp4 | 2021-10-31 10:44 | 242M | |
| John gets 'fact checked' by BBC.mp4 | 2022-01-29 17:48 | 189M | |
| John gets sick.mp4 | 2024-07-28 17:28 | 97M | |
| Join in citizen poo science, Professor Tim Spector.mp4 | 2023-03-21 16:45 | 255M | |
| Keep calm and carry on.mp4 | 2020-12-10 04:35 | 164M | |
| Kyle's vaccine complication.mp4 | 2021-10-22 20:59 | 368M | |
| Kyle's vaccine injury update.mp4 | 2022-05-14 18:21 | 137M | |
| Kyle in DC.mp4 | 2024-07-28 17:38 | 344M | |
| Lab expriments.mp4 | 2024-07-28 17:38 | 132M | |
| Lab leak conspiracy theory.mp4 | 2022-11-26 08:04 | 172M | |
| Lab leak information redacted.mp4 | 2023-03-11 16:32 | 184M | |
| Lab leak latest report.mp4 | 2022-06-12 13:53 | 161M | |
| Lab leaks.mp4 | 2024-07-28 17:38 | 78M | |
| Lab viral origins report.mp4 | 2022-09-19 22:56 | 111M | |
| Lab work report.mp4 | 2024-07-28 17:39 | 199M | |
| Lack of GMO testing.mp4 | 2024-07-28 17:39 | 110M | |
| Lambda in Peru and Texas.mp4 | 2021-07-22 22:57 | 375M | |
| Large European vaccine orders.mp4 | 2022-10-30 04:48 | 129M | |
| Large covid percentage increases.mp4 | 2022-06-20 00:58 | 149M | |
| Latest Research Findings on Embalmers Strange Clots.mp4 | 2024-07-28 17:39 | 318M | |
| Latest data, looking good.mp4 | 2021-12-05 14:01 | 160M | |
| Learning from China.mp4 | 2022-04-27 13:33 | 167M | |
| Learning from the pandemic.mp4 | 2022-12-04 03:33 | 66M | |
| Lessons from China and Africa.mp4 | 2023-01-17 17:06 | 150M | |
| Let it rip.mp4 | 2022-05-05 02:39 | 186M | |
| Lied Suddenly.mp4 | 2022-11-22 21:56 | 5.6M | |
| Lies and secrets.mp4 | 2024-07-28 17:42 | 181M | |
| Life insurers confirm excess young deaths.mp4 | 2023-08-17 11:10 | 99M | |
| Lindsay, Canada Update.mp4 | 2021-02-02 02:06 | 258M | |
| Live lesson with Tanzania.mp4 | 2020-12-17 14:33 | 382M | |
| Local doctors call for gene therapy ban.mp4 | 2025-02-17 00:02 | 59M | |
| Lockdown cause of childhood hepatitis.mp4 | 2022-07-29 13:49 | 145M | |
| Lockdown harms.mp4 | 2024-07-28 17:56 | 23M | |
| Lockdowns, weak evidence.mp4 | 2023-10-02 18:46 | 127M | |
| Lockdowns.mp4 | 2023-06-06 06:41 | 181M | |
| London research.webm | 2023-03-29 18:42 | 99M | |
| Long covid after vaccination.mp4 | 2021-08-17 14:24 | 115M | |
| Long covid and long vaccine.mp4 | 2024-07-28 17:56 | 280M | |
| Long covid in children data.mp4 | 2021-08-07 18:51 | 227M | |
| Long list of side effects to look out for.mp4 | 2022-03-13 01:42 | 181M | |
| Long term COVID.mp4 | 2020-10-26 05:07 | 249M | |
| Long term immunity, looking good.mp4 | 2020-11-19 03:10 | 534M | |
| Long term sickness increases.mp4 | 2022-11-13 00:51 | 126M | |
| Loss of lives.mp4 | 2024-07-28 17:56 | 195M | |
| Low vitamin D and increased deaths.mp4 | 2022-09-09 04:28 | 179M | |
| Lung high blood pressure.mp4 | 2024-07-28 17:57 | 188M | |
| MAHA.mp4 | 2024-11-02 21:32 | 100M | |
| MMR vaccine and COVID immunity.mp4 | 2020-11-29 07:45 | 284M | |
| Management after vaccination with Dr. Cohen.mp4 | 2023-01-24 22:55 | 188M | |
| Mandated vaccine, the science.mp4 | 2022-02-03 18:44 | 89M | |
| Mandatory vaccination debate.mp4 | 2021-07-17 04:52 | 56M | |
| March dangers and homeopathy.mp4 | 2021-01-27 20:29 | 303M | |
| Masks, no evidence they work.mp4 | 2023-03-02 23:25 | 148M | |
| Massive UK Moderna partnership.mp4 | 2022-12-23 10:34 | 130M | |
| Massive new Moderna factories and China R about 20.mp4 | 2022-12-24 19:19 | 110M | |
| Mass loss of trust.mp4 | 2021-10-25 10:00 | 237M | |
| Mass natural immunity.mp4 | 2022-05-14 13:13 | 256M | |
| Matt's messages.mp4 | 2023-03-07 06:48 | 110M | |
| MedCram discussions.mp4 | 2021-01-10 04:03 | 889M | |
| Medical advice and politicians.mp4 | 2023-03-10 23:09 | 127M | |
| Medical exemptions and Ivermectin.mp4 | 2021-03-06 05:53 | 186M | |
| Medicine, changes and intimidation.mp4 | 2023-08-07 08:10 | 106M | |
| Mel.mp4 | 2023-04-06 22:43 | 398M | |
| Menstruation changes.mp4 | 2023-09-28 04:01 | 79M | |
| Mental health, Mental illness.mp4 | 2021-03-13 20:52 | 275M | |
| Microbiome.mp4 | 2024-08-20 15:59 | 339M | |
| Microscopic evidence.mp4 | 2023-07-20 18:22 | 43M | |
| Midaz.mp4 | 2024-07-28 17:58 | 117M | |
| Mind and meds.mp4 | 2025-04-14 19:00 | 177M | |
| Mind and meds_part1_2.mp4 | 2025-04-14 19:00 | 177M | |
| Ministry of truth.mp4 | 2024-07-28 17:58 | 54M | |
| Mink mutation.mp4 | 2020-11-08 19:54 | 292M | |
| Misleading myths.mp4 | 2024-07-28 17:58 | 44M | |
| Moderna and other vaccines.mp4 | 2020-12-06 07:10 | 430M | |
| Moderna paid 400 million to NIH.mp4 | 2023-08-18 11:35 | 66M | |
| Moderna vaccine and long COVID.mp4 | 2020-12-02 00:19 | 74M | |
| Modified version.mp4 | 2023-09-21 07:57 | 110M | |
| Monday Pandemic Update, 2 sides of the pond.mp4 | 2020-12-07 23:29 | 403M | |
| Monday feedback.mp4 | 2024-12-19 01:57 | 341M | |
| Monday feedback_part1_2.mp4 | 2024-12-19 01:57 | 341M | |
| Money for antivirals.mp4 | 2021-06-20 15:31 | 206M | |
| Monkeypox, US public health emergency.mp4 | 2022-08-09 09:51 | 74M | |
| Monkeypox, emerging data.mp4 | 2022-08-09 09:16 | 174M | |
| Monkeypox, excellent news.mp4 | 2022-10-13 03:52 | 56M | |
| Monkeypox, multiple mutations confirmed.mp4 | 2022-06-17 20:50 | 164M | |
| Monkeypox, sexual spread confirmed.mp4 | 2022-07-30 01:22 | 96M | |
| Monkeypox, some global spread.mp4 | 2022-05-25 21:34 | 219M | |
| Monkeypox arrives in England.mp4 | 2022-05-20 11:46 | 252M | |
| Monkeypox homosexual spread.mp4 | 2022-07-11 08:46 | 189M | |
| Monkeypox in 5 minutes.mp4 | 2022-05-28 09:47 | 47M | |
| More asymptomatics and viral origins.mp4 | 2021-02-11 17:21 | 220M | |
| More harms and cruelty.mp4 | 2024-07-28 17:58 | 27M | |
| More vaccinated deaths than unvaccinated deaths from covid (US).mp4 | 2022-11-26 09:32 | 92M | |
| Morning Interview, Excellent vaccine news.mp4 | 2020-12-30 08:13 | 38M | |
| Mortality by vaccination status ONS critique.mp4 | 2023-01-22 20:35 | 166M | |
| Most children now have natural immunity.mp4 | 2022-02-11 02:21 | 143M | |
| Most colds non-covid.mp4 | 2022-09-30 14:42 | 134M | |
| Most common symptoms and immunity.mp4 | 2021-10-11 00:26 | 64M | |
| Most hospital admission with, not for.mp4 | 2022-07-03 05:38 | 109M | |
| Most omicron hospitalisations incidental.mp4 | 2021-12-29 19:19 | 181M | |
| Mouth wash, Colchicine and Vitamin D.mp4 | 2021-02-03 15:40 | 210M | |
| Mr. Trump comes out for vaccination.mp4 | 2021-03-20 05:43 | 224M | |
| Mr Biden and Dr Fauci and EU difficulties.mp4 | 2021-03-04 02:00 | 299M | |
| Mr Bill Gates is sad.mp4 | 2022-02-20 20:10 | 149M | |
| Mr David Davis MP and Vitamin D.mp4 | 2021-01-19 20:18 | 148M | |
| Multicultural thinking.mp4 | 2024-07-28 18:00 | 471M | |
| Multinational agreement.mp4 | 2023-08-01 07:08 | 107M | |
| Multiple sclerosis.mp4 | 2023-05-29 07:31 | 179M | |
| Mutation in Denmark.mp4 | 2020-11-06 19:12 | 163M | |
| Mutation update and UK flattening.mp4 | 2020-11-08 02:31 | 192M | |
| Myocardial disease clip.mp4 | 2023-06-11 16:23 | 26M | |
| Myocarditis, don't bother to report.mp4 | 2023-08-23 14:45 | 109M | |
| Myocarditis, good news.mp4 | 2022-11-08 13:22 | 93M | |
| Myocarditis German evidence.mp4 | 2022-12-04 18:14 | 91M | |
| Myocarditis after vaccination, firm data.mp4 | 2022-02-12 12:37 | 268M | |
| Myocarditis data from Korea.mp4 | 2023-06-17 14:44 | 47M | |
| Myocarditis paper.mp4 | 2024-07-28 18:00 | 308M | |
| Mystery pneumonia in China.mp4 | 2024-07-28 18:00 | 101M | |
| My vitamin D results.mp4 | 2021-02-26 14:44 | 308M | |
| My yellow card report.mp4 | 2022-12-19 17:13 | 80M | |
| NHS ... information.mp4 | 2024-07-28 18:29 | 54M | |
| NIH, Wuhan were working on monkeypox.mp4 | 2022-06-06 23:27 | 183M | |
| NIH and ivermectin.mp4 | 2021-10-20 17:14 | 183M | |
| NIH confirms our fears.mp4 | 2025-04-24 10:57 | 56M | |
| Nanny State knows best.mp4 | 2025-01-12 10:19 | 76M | |
| Natural cross immunity confirmed.mp4 | 2022-11-30 06:04 | 118M | |
| Natural immunity, answers.mp4 | 2022-02-23 19:20 | 119M | |
| Natural immunity in Italy.mp4 | 2022-11-28 22:47 | 87M | |
| Natural immunity in Portugal.mp4 | 2022-09-03 11:57 | 163M | |
| Natural immunity key in US.mp4 | 2021-06-20 09:10 | 141M | |
| Natural immunity protects.mp4 | 2022-11-23 06:28 | 223M | |
| Natural immunity strategy needed.mp4 | 2022-02-27 21:59 | 143M | |
| Natural immunity wins.mp4 | 2023-08-31 17:11 | 135M | |
| Natural immunity with Dr Pilz.mp4 | 2022-02-18 00:55 | 66M | |
| Natural versus vaccine immunity.mp4 | 2021-11-03 15:06 | 231M | |
| Need for vaccine aspiration confirmed, why is this not being done.mp4 | 2021-12-04 10:07 | 128M | |
| Negative vaccine immunity proved.mp4 | 2025-03-31 01:05 | 67M | |
| New CDC guidance and Sputnik looking good.mp4 | 2021-02-12 14:04 | 488M | |
| New Hope Children's Centre, Uplands, Kenya.mp4 | 2022-09-10 16:16 | 115M | |
| New Hope Children's Centre.mp4 | 2022-09-11 22:06 | 178M | |
| New Pfizer drug and ivermectin.mp4 | 2021-11-10 06:47 | 241M | |
| New US Vit D research.webm | 2023-04-04 00:13 | 222M | |
| New US vaccine and a missing mutant.mp4 | 2021-03-02 09:24 | 246M | |
| New York and China.mp4 | 2022-06-11 22:03 | 136M | |
| New advice on covid vaccination in pregnancy.mp4 | 2022-09-01 06:44 | 127M | |
| New and damning evidence.mp4 | 2024-07-28 18:26 | 69M | |
| New antiviral drug in trials.mp4 | 2021-03-27 14:41 | 169M | |
| New brain virus.mp4 | 2024-07-28 18:26 | 215M | |
| New coronavirus variant, spread and significance.mp4 | 2020-12-24 15:58 | 76M | |
| New covid vaccine for UK.mp4 | 2022-08-21 00:59 | 179M | |
| New evidence.mp4 | 2021-07-03 11:07 | 259M | |
| New form of immunization.mp4 | 2023-07-12 15:02 | 512M | |
| New international health regulations, James Roguski.mp4 | 2023-05-31 09:31 | 406M | |
| New mRNA trial suspended.mp4 | 2024-12-23 09:11 | 144M | |
| New research game changer.mp4 | 2020-11-16 00:08 | 238M | |
| New safe form of immunization.mp4 | 2024-07-28 18:27 | 194M | |
| New syndrome.mp4 | 2024-07-28 18:27 | 200M | |
| New treatment for depression.mp4 | 2022-08-25 23:03 | 198M | |
| New variant, same symptoms.mp4 | 2021-02-14 07:45 | 324M | |
| New variant causes more symptoms.mp4 | 2021-01-29 16:40 | 334M | |
| New viral strain spreads through UK.mp4 | 2020-12-30 09:04 | 292M | |
| New virus from China_.mp4 | 2025-01-13 17:08 | 60M | |
| No BA.2 US bounce.mp4 | 2022-04-27 23:38 | 110M | |
| No apparent covid in Africa.mp4 | 2022-12-28 16:34 | 167M | |
| Non covid excess deaths.mp4 | 2022-07-06 16:28 | 149M | |
| No protection against death.mp4 | 2024-07-28 18:29 | 59M | |
| North Korea and China, mass irrationality.mp4 | 2022-05-22 18:51 | 164M | |
| Northern hemisphere good news.mp4 | 2022-05-02 22:41 | 174M | |
| November Pandemic Update.mp4 | 2020-11-01 21:36 | 266M | |
| Now and the next months.mp4 | 2021-10-11 00:03 | 142M | |
| ONS, overall deaths in unvaccinated lower.mp4 | 2023-09-26 19:56 | 28M | |
| ONS sample group discussion.mp4 | 2022-10-24 22:51 | 207M | |
| Official denial.mp4 | 2024-07-28 18:30 | 171M | |
| Official investigation, tittle tattle.mp4 | 2024-07-28 18:30 | 46M | |
| Off sick for a couple of days.mp4 | 2021-04-10 08:54 | 69M | |
| Omicron, Common cold symptoms.mp4 | 2021-12-18 13:23 | 167M | |
| Omicron, SA, UK, US in that order.mp4 | 2022-01-19 13:12 | 192M | |
| Omicron, as anticipated.mp4 | 2022-01-05 22:05 | 182M | |
| Omicron, first case report from SA.mp4 | 2021-12-02 10:03 | 19M | |
| Omicron, global exposure.mp4 | 2021-12-11 13:20 | 189M | |
| Omicron, half of common colds.mp4 | 2021-12-24 12:16 | 153M | |
| Omicron, orientation and unknowns.mp4 | 2021-12-31 03:09 | 152M | |
| Omicron, should I expose myself_.mp4 | 2022-01-25 05:09 | 245M | |
| Omicron, so far so good.mp4 | 2021-12-28 18:03 | 243M | |
| Omicron, symptom changes.mp4 | 2021-12-09 12:46 | 240M | |
| Omicron BA. 2.75.mp4 | 2022-07-14 12:44 | 122M | |
| Omicron BA. 2 will displace BA. 1.mp4 | 2022-01-28 09:07 | 137M | |
| Omicron UK surge.mp4 | 2021-12-15 08:30 | 156M | |
| Omicron does reinfect after natural infection.mp4 | 2021-12-04 06:12 | 92M | |
| Omicron dominates in US.mp4 | 2021-12-22 00:38 | 209M | |
| Omicron emergency interview.mp4 | 2021-12-13 16:47 | 50M | |
| Omicron from mice.mp4 | 2022-01-07 21:06 | 183M | |
| Omicron good news.mp4 | 2021-12-01 00:38 | 98M | |
| Omicron growth for next two weeks.mp4 | 2022-01-07 18:22 | 195M | |
| Omicron growth in Norway.mp4 | 2021-12-11 15:43 | 239M | |
| Omicron has peaked in UK.mp4 | 2022-01-15 01:13 | 208M | |
| Omicron hits Europe.mp4 | 2021-12-19 07:11 | 55M | |
| Omicron in London and New York.mp4 | 2021-12-26 17:23 | 161M | |
| Omicron in the US, increased transmissibility confirmed.mp4 | 2021-12-02 11:47 | 32M | |
| Omicron is displacing delta science.mp4 | 2022-01-02 19:16 | 203M | |
| Omicron objectivity.mp4 | 2021-11-29 01:59 | 260M | |
| Omicron outcompetes omicron, official data.mp4 | 2022-01-30 19:50 | 205M | |
| Omicron predictions.mp4 | 2021-12-17 23:17 | 207M | |
| Omicron presentation in Israel.mp4 | 2022-01-25 17:04 | 300M | |
| Omicron reducing intensive care admissions.mp4 | 2022-02-04 16:18 | 133M | |
| Omicron science, good news.mp4 | 2021-12-30 18:56 | 153M | |
| Omicron spreading between animals.mp4 | 2022-02-09 01:43 | 179M | |
| Omicron supremacy.mp4 | 2023-04-02 06:53 | 117M | |
| Omicron variants drive summer increases.mp4 | 2022-06-23 11:43 | 193M | |
| One in 35.mp4 | 2023-07-26 08:38 | 199M | |
| One million US deaths.mp4 | 2022-05-12 05:57 | 149M | |
| One vaccine dose and two viral variants.mp4 | 2021-02-20 22:36 | 309M | |
| Opposing Views_ COVID _ Dr. Mercola and Dr. Kamil - Mikhaila Peterson Podcast #77.mp4 | 2021-05-26 14:35 | 1.2G | |
| Optimism and anxiety.mp4 | 2024-11-20 12:12 | 82M | |
| Our mRNA fears.mp4 | 2025-03-30 08:44 | 114M | |
| Outrageous.mp4 | 2024-07-28 18:31 | 166M | |
| Over 15,000 UK daily infections in vaccinated.mp4 | 2021-07-18 01:55 | 255M | |
| Over half a million US tragic deaths.mp4 | 2021-02-24 14:01 | 218M | |
| Ovulation and implantation.mp4 | 2025-02-18 10:21 | 35M | |
| Oxford Vaccine Approved.mp4 | 2020-12-30 16:44 | 204M | |
| Oxford vaccine, looking very good.mp4 | 2020-11-29 19:07 | 244M | |
| POTUS, Pandemic is over.mp4 | 2022-09-23 05:22 | 133M | |
| Pandemic, Australia, US, UK.mp4 | 2020-12-23 19:19 | 260M | |
| Pandemic, Global surge.mp4 | 2021-01-12 22:40 | 227M | |
| Pandemic, Tuesday 15 Dec.mp4 | 2020-12-22 00:45 | 279M | |
| Pandemic, US Update.mp4 | 2020-10-16 15:24 | 283M | |
| Pandemic, winter worries.mp4 | 2020-12-16 16:34 | 286M | |
| Pandemic Global Update.mp4 | 2020-10-26 10:51 | 277M | |
| Pandemic changing age profiles.mp4 | 2021-09-20 01:33 | 125M | |
| Pandemic ends Thursday.mp4 | 2022-02-21 22:32 | 144M | |
| Pandemic failures.mp4 | 2022-09-18 13:28 | 97M | |
| Pandemic good news.mp4 | 2022-09-20 23:46 | 63M | |
| Pandemic in Canada.mp4 | 2020-11-30 02:05 | 198M | |
| Pandemic in Europe and UK.mp4 | 2020-10-15 04:03 | 202M | |
| Pandemic in UK and Europe.mp4 | 2020-10-17 14:06 | 287M | |
| Pandemic lockdown in Wales.mp4 | 2020-10-20 02:32 | 70M | |
| Pandemic optimism, excess deaths pessimism.mp4 | 2022-09-04 10:51 | 149M | |
| Pandemic optimism.mp4 | 2021-08-22 13:20 | 306M | |
| Pandemic origin.mp4 | 2021-01-09 03:22 | 271M | |
| Pandemic record numbers of new infections.mp4 | 2022-07-15 14:53 | 105M | |
| Pandemics and ivermectin safety.mp4 | 2021-09-25 05:20 | 798M | |
| Pandemic second wave.mp4 | 2020-11-02 01:13 | 303M | |
| Pandemic treaty.mp4 | 2024-07-28 18:31 | 113M | |
| Pandemic unnecessary deaths, the data.mp4 | 2023-02-16 02:54 | 232M | |
| Pandemic update, people and gorillas.mp4 | 2021-01-14 05:33 | 231M | |
| Pandemic update and risk to children.mp4 | 2020-12-27 13:30 | 262M | |
| Pandemic weekend update.mp4 | 2020-12-22 10:47 | 350M | |
| Parliamentary speech on excess deaths.mp4 | 2024-07-28 18:32 | 178M | |
| Party time.webm | 2023-06-19 15:51 | 35M | |
| Paxlovid, evidence base_.mp4 | 2022-05-06 00:55 | 198M | |
| Peoples vaccine inquiry.mp4 | 2025-02-12 05:09 | 60M | |
| Pericarditis after vaccine.mp4 | 2021-12-18 06:22 | 928M | |
| Pfizer, blanked out pages.mp4 | 2022-10-21 09:08 | 155M | |
| Pfizer, illegal exploitation.mp4 | 2022-08-05 16:30 | 129M | |
| Pfizer, process 2.mp4 | 2023-10-03 11:31 | 105M | |
| Pfizer court case, Kansas.mp4 | 2024-07-28 18:33 | 49M | |
| Pfizer fails to answer.mp4 | 2023-08-27 10:26 | 162M | |
| Pfizer is 'deeply sorry'.mp4 | 2024-07-28 18:33 | 131M | |
| Pfizer issue a press statement.mp4 | 2023-01-29 00:23 | 94M | |
| Pfizer new antiviral.mp4 | 2021-11-07 19:46 | 291M | |
| Pfizer press release continues.mp4 | 2023-02-04 20:36 | 183M | |
| Pfizer vaccine and immunity.mp4 | 2020-12-04 08:09 | 83M | |
| Pioneering Vitamin D researcher.mp4 | 2024-07-28 18:35 | 617M | |
| Pirola panic.mp4 | 2023-08-30 18:13 | 158M | |
| Please send to politicians.mp4 | 2022-02-19 22:38 | 155M | |
| Pneumonia and Vitamin A in China.mp4 | 2024-07-28 18:36 | 219M | |
| Polio in England.mp4 | 2022-06-23 12:39 | 159M | |
| Polio vac for all London children.mp4 | 2022-08-11 22:26 | 148M | |
| Political issues in covid.mp4 | 2021-08-18 04:36 | 165M | |
| Politicians for the people.mp4 | 2024-11-23 17:27 | 55M | |
| Positive UK data.mp4 | 2021-12-23 17:17 | 62M | |
| Possible UK surge.mp4 | 2021-03-10 18:00 | 239M | |
| Post covid Alzheimer's.mp4 | 2022-09-27 01:56 | 162M | |
| Post covid brain disorders.mp4 | 2022-09-28 01:27 | 182M | |
| Post covid myocarditis_.mp4 | 2023-03-23 21:18 | 139M | |
| Post infection immunity, good news.mp4 | 2021-01-05 09:15 | 195M | |
| Post vaccination contagion.mp4 | 2021-01-25 16:48 | 349M | |
| Post vaccine deaths.mp4 | 2021-02-18 05:30 | 279M | |
| Post vaccine myocarditis.mp4 | 2021-04-29 06:08 | 419M | |
| Post vaccine myocarditis update.mp4 | 2021-05-26 00:11 | 186M | |
| Post viral syndrome data.mp4 | 2024-07-28 18:37 | 76M | |
| Power of the State.mp4 | 2024-07-28 18:37 | 72M | |
| Pre-infection advice.mp4 | 2022-01-15 19:32 | 151M | |
| Pre vaccine fatality rates.mp4 | 2022-10-28 05:18 | 147M | |
| Prevalence remains high.mp4 | 2022-02-18 22:43 | 115M | |
| Prevalence remains high_part1_2.mp4 | 2021-10-07 06:23 | 279M | |
| Problems before vaccine arrives, 27 November.mp4 | 2020-11-30 12:46 | 572M | |
| Problems in Europe.mp4 | 2021-03-15 16:19 | 221M | |
| Professor Angus Dalgleish, full interview.mp4 | 2024-10-23 06:32 | 180M | |
| Professor Clancy, long covid and immunity.mp4 | 2023-03-20 05:56 | 1.2G | |
| Professor Clancy responds to TGA document.mp4 | 2023-03-25 20:00 | 311M | |
| Professor Dalgleish.mp4 | 2023-10-06 15:51 | 307M | |
| Professor David Anderson.mp4 | 2024-07-28 18:38 | 348M | |
| Professor Hoiby, message to world leaders.mp4 | 2021-12-20 12:46 | 216M | |
| Professor Paul Hunter, interview.mp4 | 2021-06-12 17:48 | 335M | |
| Professor Raghad in Iraq.mp4 | 2021-07-30 21:04 | 259M | |
| Professor Tim Spector discussion.mp4 | 2021-03-26 01:01 | 407M | |
| Project Veritas - 1,000,000+ views in 90 minutes #DirectedEvolution setting the internet on fire 🔥🔥🔥.mp4 | 2023-01-25 19:21 | 21M | |
| Project fear.mp4 | 2024-07-28 18:38 | 32M | |
| Proof.mp4 | 2024-07-28 18:38 | 51M | |
| Psilocybin, Australian re scheduling.mp4 | 2023-04-10 04:00 | 219M | |
| Psychedelic censorship.mp4 | 2025-04-21 18:02 | 130M | |
| Psychedelics with Professor David Nutt.mp4 | 2025-03-13 23:09 | 794M | |
| Psychological themes.mp4 | 2024-07-28 18:38 | 213M | |
| Putin's mind, is he mad_.mp4 | 2022-02-28 23:25 | 510M | |
| Quality Australian vaccine data.mp4 | 2023-07-13 08:47 | 211M | |
| Quazi religious governmental complex.mp4 | 2024-07-28 18:38 | 21M | |
| Questions about me and other pandemics.mp4 | 2021-05-11 08:15 | 239M | |
| Questions for FDA.mp4 | 2021-08-25 12:39 | 234M | |
| Questions from Australian Senators.mp4 | 2023-02-22 02:07 | 163M | |
| Question to prime minister.mp4 | 2024-07-28 18:38 | 63M | |
| Radiation risk to Europe.mp4 | 2022-08-10 14:27 | 145M | |
| Rampant BA 5.mp4 | 2022-07-23 13:34 | 136M | |
| Rapid viral evolution.mp4 | 2022-07-01 19:07 | 180M | |
| Rare complications.mp4 | 2023-01-14 19:39 | 181M | |
| Reasonable worst case scenario.mp4 | 2024-07-28 18:38 | 24M | |
| Reclaiming food and medicine.mp4 | 2024-07-28 18:39 | 251M | |
| Record UK Prevalence, one in 19.mp4 | 2022-03-27 10:31 | 164M | |
| Record excess deaths in Europe.mp4 | 2022-09-19 03:03 | 76M | |
| Regulators agree on vaccination.mp4 | 2021-03-20 20:55 | 53M | |
| Reinfection rate, very low.mp4 | 2021-01-15 07:38 | 314M | |
| Reinfection with South African variant.mp4 | 2021-02-15 18:00 | 329M | |
| Report from Oregon.mp4 | 2021-01-04 13:01 | 377M | |
| Repurposed drugs are cheap.mp4 | 2023-02-07 22:58 | 460M | |
| Review, infections and complications.mp4 | 2022-03-07 22:35 | 200M | |
| Revolving door spins.mp4 | 2023-08-19 04:33 | 63M | |
| Risk from India double mutation.mp4 | 2021-04-19 15:44 | 190M | |
| Risks and benefits with Professor Fenton.mp4 | 2022-12-12 18:02 | 402M | |
| Risks following infection versus vaccination.mp4 | 2021-09-07 04:16 | 197M | |
| Romanian perspectives.mp4 | 2022-02-07 01:24 | 248M | |
| Rule changes for fully vaccinated.mp4 | 2021-05-15 11:13 | 298M | |
| SAGE omicron leak.mp4 | 2021-12-01 22:19 | 48M | |
| Sad excess deaths.mp4 | 2023-09-08 18:17 | 87M | |
| Sad excess deaths_part1_2.mp4 | 2023-09-10 02:26 | 81M | |
| Safe and effective.mp4 | 2024-07-28 18:44 | 86M | |
| Saturday 3 April Update.mp4 | 2021-04-03 20:03 | 276M | |
| Scabies and ivermectin.mp4 | 2024-07-28 18:45 | 57M | |
| Science indicates less severe omicron disease.mp4 | 2022-01-03 18:55 | 260M | |
| Scientific integrity.mp4 | 2024-10-28 04:13 | 124M | |
| Scotland and Australia.mp4 | 2021-02-22 11:33 | 227M | |
| Scottish Vaccine Injury Group.mp4 | 2025-01-28 06:30 | 236M | |
| Second Vitamin D clinical trial, positive results.mp4 | 2020-11-30 01:31 | 211M | |
| Second Wave Update.mp4 | 2020-11-14 16:50 | 376M | |
| Second vaccine with high immunity.mp4 | 2020-11-17 02:24 | 460M | |
| Secrets.mp4 | 2024-07-28 18:46 | 698M | |
| Senator Rennick, full interview.mp4 | 2023-03-25 01:42 | 302M | |
| Serious DNA contamination.mp4 | 2025-03-12 01:26 | 32M | |
| Serious adverse events.mp4 | 2023-09-11 17:15 | 314M | |
| Severe illness after vaccination.mp4 | 2021-11-01 08:51 | 392M | |
| Shroud studies.mp4 | 2024-10-29 09:16 | 125M | |
| Sick children in South Africa.mp4 | 2021-12-05 00:02 | 96M | |
| Simple questions for Pfizer.mp4 | 2023-08-05 06:47 | 57M | |
| Sinister developments.mp4 | 2023-09-29 16:24 | 338M | |
| Sir Christopher Chope.mp4 | 2023-03-29 04:50 | 130M | |
| Some permanent long covid.mp4 | 2022-08-06 21:26 | 193M | |
| South Africa.mp4 | 2020-11-08 16:28 | 275M | |
| South Africa Omicron.mp4 | 2021-12-15 20:36 | 204M | |
| South Africa VOC in Europe.mp4 | 2021-04-01 19:28 | 307M | |
| Spain, convincing therapeutic evidence.mp4 | 2021-02-13 22:09 | 237M | |
| Specialists now agree on endemic ending.mp4 | 2022-01-16 17:37 | 198M | |
| Spinal cord injury after covid vaccines.mp4 | 2025-04-05 14:24 | 133M | |
| Spontaneous abortion after vaccine.mp4 | 2021-11-27 20:10 | 270M | |
| Spread in US schools.mp4 | 2021-08-29 12:20 | 111M | |
| Sputnik V peer reviewed.mp4 | 2021-02-07 23:09 | 324M | |
| Staff increased 20 fold.mp4 | 2023-03-28 10:31 | 95M | |
| Standing on the shoulders of giants.mp4 | 2024-07-28 18:53 | 515M | |
| Stroke.mp4 | 2024-07-28 18:53 | 188M | |
| Study confirms omicron reinfections.mp4 | 2022-01-28 08:49 | 239M | |
| Successful patient care after vaccination.mp4 | 2023-01-31 13:03 | 224M | |
| Suddenly Falls Over at Public Order Emergency Commission-kGtkVp8Kaxo-720p-1654917201449.mp4 | 2022-11-20 09:08 | 2.4M | |
| Sunday Pandemic Update.mp4 | 2020-10-18 22:20 | 394M | |
| Superior natural immunity.mp4 | 2022-04-15 09:23 | 181M | |
| Sweden, lockdowns did not work.mp4 | 2023-03-27 15:47 | 122M | |
| Sweden.mp4 | 2023-03-27 15:29 | 197M | |
| Swindon heart complications, good news.mp4 | 2023-01-07 20:57 | 106M | |
![[SND]](/icons/sound2.gif) | Swiss vaccination.m4a | 2023-04-10 18:38 | 13M | |
| Symptomatic covid plummets.mp4 | 2022-08-12 21:53 | 244M | |
| Symptom change and waning protection.mp4 | 2021-09-20 09:50 | 85M | |
| Symptoms and Sequelae.mp4 | 2022-01-09 22:44 | 258M | |
| Symptom tracker and the next pandemic.mp4 | 2021-02-08 10:23 | 293M | |
| Taiwan and South Africa.mp4 | 2021-07-19 22:02 | 145M | |
| Thai vaccine heart complications.mp4 | 2022-08-18 11:39 | 186M | |
| Thanksgiving surge inevitable.mp4 | 2020-11-29 22:31 | 227M | |
| The 4 lighthouse declarations.mp4 | 2024-07-28 18:56 | 145M | |
| The Australian Protocol.mp4 | 2021-12-22 18:59 | 256M | |
| The Banality of Evil.mp4 | 2024-12-14 08:06 | 129M | |
| The Code.mp4 | 2023-09-13 07:34 | 146M | |
| The Death of Science.mp4 | 2024-07-28 18:58 | 322M | |
| The Natural Doctor.mp4 | 2022-03-15 07:06 | 318M | |
| The O variant.mp4 | 2021-11-30 13:43 | 264M | |
| The Pfizer documents.mp4 | 2022-07-18 20:31 | 209M | |
| The Predicted Heart Failure Epidemic is Here!.mp4 | 2024-07-28 19:01 | 65M | |
| The Semmelweis story.mp4 | 2025-02-06 02:54 | 99M | |
| The Start of Covid Vaccine Lawsuits.mp4 | 2024-07-28 19:04 | 35M | |
| The UK experiment.mp4 | 2021-07-07 14:45 | 169M | |
| The UK paradox.mp4 | 2021-07-31 01:50 | 66M | |
| The Vitamin D debate with Professor Spector.mp4 | 2021-04-06 19:12 | 271M | |
| The biggest HEALTH DISASTER of ALL TIME.mp4 | 2024-09-06 00:33 | 278M | |
| The corruption of evidence based medicine.mp4 | 2023-01-20 06:14 | 235M | |
| The curious tale of hydroxychloroquine.mp4 | 2024-07-28 18:58 | 101M | |
| The illusion of evidence based medicine.mp4 | 2022-03-30 13:50 | 291M | |
| The next COVID year and vaccine function.mp4 | 2020-11-15 19:36 | 300M | |
| Therapeutic cannabis with Professor Brighthope.mp4 | 2025-04-08 15:20 | 333M | |
| Therapeutics update.mp4 | 2021-04-13 23:40 | 185M | |
| Theraputic mouth wash, allergies and stomach acid.mp4 | 2020-12-13 04:06 | 244M | |
| Third vaccine dose.mp4 | 2021-05-21 17:59 | 199M | |
| Thursday 10 December Pandemic Update.mp4 | 2020-12-21 12:58 | 210M | |
| Tim Spector, metallic taste after vaccination.mp4 | 2022-03-02 18:15 | 49M | |
| Time to prepare for omicron exposure.mp4 | 2021-12-19 08:27 | 32M | |
| Toxic food.mp4 | 2024-08-26 01:09 | 93M | |
| Transatlantic data burst.mp4 | 2022-04-06 21:24 | 215M | |
| Transatlantic update and personal experience.mp4 | 2021-02-15 15:20 | 180M | |
| Transparancy leading to massive reserch opportunities.mp4 | 2025-03-06 19:47 | 46M | |
| Triggernometry interview, perceptive questions.mp4 | 2023-04-05 18:23 | 1.3G | |
| Trump's Presidential Health Review.mp4 | 2024-11-20 17:25 | 80M | |
| Tucker Carlson interviews Dr Aseem Malhotra on the corruption of medicine by Big Pharma.mp4 | 2022-12-22 12:22 | 112M | |
| Tuesday Update.mp4 | 2021-04-07 00:23 | 260M | |
| Tuesday debate.mp4 | 2021-07-18 10:50 | 233M | |
| Turbo cancers.mp4 | 2024-11-02 01:03 | 90M | |
| Two new vaccines work.mp4 | 2021-02-08 06:30 | 303M | |
| Two vaccine shots, implications.mp4 | 2021-05-01 19:33 | 297M | |
| UK, 4.49 m cases now.mp4 | 2022-04-04 01:07 | 153M | |
| UK, 50% omicron now.mp4 | 2021-12-13 15:31 | 166M | |
| UK, Critical time.mp4 | 2021-01-12 07:47 | 219M | |
| UK, Decline and Fall.mp4 | 2021-07-28 00:53 | 495M | |
| UK, Groundhog day.mp4 | 2022-04-25 15:07 | 312M | |
| UK, down and down.mp4 | 2021-07-27 18:07 | 255M | |
| UK, pandemic record infections.mp4 | 2022-03-25 18:21 | 141M | |
| UK Omicron emergency announced.mp4 | 2021-12-12 19:21 | 188M | |
| UK Pandemic Update.mp4 | 2020-11-01 09:09 | 273M | |
| UK Parliament vaccine debate.mp4 | 2022-11-09 16:29 | 208M | |
| UK R is 1, CDC out of date.mp4 | 2021-07-31 22:58 | 274M | |
| UK and Immunity.mp4 | 2020-11-01 15:59 | 64M | |
| UK and South Africa new viral variant.mp4 | 2020-12-25 02:41 | 282M | |
| UK cases increase, Australia reports.mp4 | 2021-05-22 22:58 | 187M | |
| UK cases level, India increases.mp4 | 2021-03-26 18:55 | 279M | |
| UK confusing vaccination guidelines.mp4 | 2022-09-03 01:47 | 108M | |
| UK data, massive shift in vaccine risk _ benefit analysis.mp4 | 2023-01-27 23:15 | 125M | |
| UK data with glaring omissions.mp4 | 2022-04-14 16:43 | 354M | |
| UK excess deaths increase.mp4 | 2023-01-10 06:26 | 93M | |
| UK hospital admissions will rise.mp4 | 2021-07-20 21:40 | 250M | |
| UK moves to endemic.mp4 | 2021-04-30 09:27 | 197M | |
| UK peaks, China locks down.mp4 | 2022-04-12 13:22 | 273M | |
| UK reopens, Brazil reports.mp4 | 2021-05-18 00:39 | 220M | |
| UK surge continues.mp4 | 2022-04-01 07:13 | 183M | |
| UK update, 30th November.mp4 | 2020-12-01 14:13 | 379M | |
| UK vaccines data.mp4 | 2021-05-01 14:46 | 220M | |
| UK variant increases mortality.mp4 | 2021-03-13 09:59 | 298M | |
| UK wins reopening gamble_.mp4 | 2021-08-06 02:10 | 232M | |
| US, Best guess.mp4 | 2022-04-12 18:32 | 114M | |
| US, Mass disabling event.mp4 | 2022-09-22 01:31 | 77M | |
| US, UK Tanzania, Russia.mp4 | 2021-03-21 17:04 | 301M | |
| US, UK and viral survival on skin.mp4 | 2020-10-21 07:31 | 380M | |
| US, Vaccine immune escape.mp4 | 2021-07-18 04:33 | 216M | |
| US, delta 83%.mp4 | 2021-07-25 21:26 | 430M | |
| US, learning from Zambia.mp4 | 2021-02-24 01:00 | 147M | |
| US, new omicrons.mp4 | 2022-06-12 18:59 | 205M | |
| US, subvarient excellent news.mp4 | 2022-04-26 00:19 | 124M | |
| USA debate.mp4 | 2021-07-01 18:58 | 273M | |
| US Energy department and FBI agree on Lab leak.mp4 | 2023-03-02 23:06 | 132M | |
| US Intelligence final report.mp4 | 2023-07-02 09:41 | 429M | |
| US Long Covid 20% of cases.mp4 | 2022-05-27 22:25 | 173M | |
| US Pandemic Update.mp4 | 2020-11-01 17:49 | 213M | |
| US Pandemic increases.mp4 | 2020-12-23 16:26 | 132M | |
| US Senate, lab origin most likely.mp4 | 2022-10-31 18:21 | 196M | |
| US and China and BA 2.mp4 | 2022-03-28 23:12 | 165M | |
| US and Europe, increases.mp4 | 2021-01-11 17:25 | 345M | |
| US and UK, mutations and vitamin D.mp4 | 2020-11-10 20:04 | 412M | |
| US cases and vaccinations up.mp4 | 2021-08-01 23:48 | 216M | |
| US cases decline, risk calculator from Australia.mp4 | 2022-01-31 22:20 | 52M | |
| US changes, UK problems.mp4 | 2021-01-24 07:49 | 345M | |
| US data arrives.mp4 | 2021-08-21 08:33 | 223M | |
| US delta and more long covid.mp4 | 2021-07-08 19:01 | 158M | |
| US difficulties and UK lockdown.mp4 | 2020-11-04 17:54 | 167M | |
| US following UK.mp4 | 2022-04-02 15:46 | 157M | |
| US hits the million cases.mp4 | 2022-01-04 19:11 | 304M | |
| US hospital concerns.mp4 | 2022-01-13 21:04 | 179M | |
| US hospitalisations and mask wearing.mp4 | 2020-11-13 06:59 | 401M | |
| US hospital patient remain high.mp4 | 2022-01-23 02:26 | 193M | |
| US omicron surge now.mp4 | 2021-12-20 22:19 | 190M | |
| US pause Janssen vaccine.mp4 | 2021-04-14 17:10 | 178M | |
| US possible resurgence, SA possible mistake.mp4 | 2021-02-17 19:03 | 453M | |
| US record breaking cases and hospitalizations.mp4 | 2022-01-12 08:05 | 181M | |
| US third wave.mp4 | 2021-07-20 22:38 | 338M | |
| US trends, ventilation and low cost vaccine.mp4 | 2020-11-21 17:54 | 396M | |
| US up, UK down and vaccines in pregnancy.mp4 | 2021-08-05 01:37 | 366M | |
| US update.mp4 | 2020-11-30 22:07 | 277M | |
| US vaccine intervals increased.mp4 | 2022-02-25 18:06 | 157M | |
| Uganda, Special report.mp4 | 2021-07-18 12:21 | 217M | |
| Uganda community based health care.mp4 | 2022-09-18 06:21 | 271M | |
| Understanding immunity and inflammation, part 1.mp4 | 2023-02-07 20:47 | 305M | |
| Unethical drug and vaccine ads.mp4 | 2023-08-03 20:35 | 31M | |
| United States, vaccinating well.mp4 | 2021-03-16 22:39 | 223M | |
| United States and Australia.mp4 | 2021-07-28 06:09 | 219M | |
| United States hospital pressures.mp4 | 2021-08-27 15:33 | 411M | |
| United States situation.mp4 | 2022-04-15 03:19 | 156M | |
| Unnecessary deaths in India.mp4 | 2021-04-24 15:46 | 281M | |
| Unstable endemicity.mp4 | 2022-07-19 11:29 | 94M | |
| Update, Wed 16 Dec.mp4 | 2020-12-23 01:57 | 340M | |
| Update and Brazil report.mp4 | 2021-01-26 18:22 | 94M | |
| Update and COVID verses Influenza.mp4 | 2020-11-03 18:49 | 330M | |
| Update and Delta Plus variant.mp4 | 2021-06-24 10:34 | 264M | |
| Update from John.mp4 | 2024-11-19 21:43 | 147M | |
| VAERS data with Dr Jessica Rose.mp4 | 2024-07-28 19:21 | 146M | |
| Vaccination, excellent news.mp4 | 2020-12-30 07:46 | 26M | |
| Vaccination advice in the age of omicron.mp4 | 2022-01-17 23:14 | 277M | |
| Vaccination and disease transmission.mp4 | 2024-07-28 19:21 | 182M | |
| Vaccination and ivermectin.mp4 | 2021-06-15 21:39 | 231M | |
| Vaccination disappointments.mp4 | 2021-11-21 17:40 | 283M | |
| Vaccination in immune compromise.mp4 | 2021-03-09 14:39 | 311M | |
| Vaccination in pregnancy.mp4 | 2021-04-18 17:34 | 265M | |
| Vaccination or natural immunity.mp4 | 2022-06-23 00:18 | 183M | |
| Vaccination problems, UK Parliament.mp4 | 2023-03-20 22:04 | 163M | |
| Vaccinations and US hospitalizations.mp4 | 2020-12-05 11:17 | 231M | |
| Vaccinations in December.mp4 | 2020-11-23 07:48 | 90M | |
| Vaccinations slow, new variant fast.mp4 | 2021-01-06 08:29 | 265M | |
| Vaccination status.mp4 | 2022-10-03 02:32 | 108M | |
| Vaccination v excess deaths, correlation study.mp4 | 2023-03-22 00:13 | 149M | |
| Vaccine, game changer.mp4 | 2020-11-12 11:52 | 252M | |
| Vaccine, looking very good.mp4 | 2020-11-19 01:22 | 262M | |
| Vaccine RNA in breast milk.mp4 | 2022-10-09 21:04 | 146M | |
| Vaccine adverse events, German data.mp4 | 2022-08-07 01:29 | 113M | |
| Vaccine adverse reactions, reanalysis of mRNA trial data.mp4 | 2022-12-30 19:23 | 133M | |
| Vaccine approval and rollout.mp4 | 2020-12-03 17:50 | 82M | |
| Vaccine brain injury.mp4 | 2025-01-30 23:03 | 64M | |
| Vaccine breakthrough infections.mp4 | 2021-07-17 23:17 | 271M | |
| Vaccine collusion in UK Parliament_.mp4 | 2023-03-23 03:58 | 71M | |
| Vaccine dangers, UK Parliament debate.mp4 | 2022-12-13 19:14 | 151M | |
| Vaccine dangers debate.mp4 | 2022-11-11 14:25 | 184M | |
| Vaccine data from Florida.mp4 | 2023-02-17 17:45 | 157M | |
| Vaccine debate.mp4 | 2022-11-06 20:02 | 98M | |
| Vaccine effectiveness and longevity in UK.mp4 | 2021-08-19 15:55 | 218M | |
| Vaccine injuries reported.mp4 | 2024-07-28 19:21 | 130M | |
| Vaccine long term effects.mp4 | 2025-03-28 19:39 | 111M | |
| Vaccine mRNA contaminates breast milk.mp4 | 2023-09-22 08:28 | 158M | |
| Vaccine mandates.mp4 | 2021-09-21 10:18 | 61M | |
| Vaccine mandates_part1_2.mp4 | 2021-09-20 05:28 | 74M | |
| Vaccine manufacture full interview.mp4 | 2023-10-04 05:45 | 375M | |
| Vaccine moratorium.mp4 | 2024-10-15 07:42 | 67M | |
| Vaccine news.mp4 | 2021-06-13 15:46 | 205M | |
| Vaccine reanalysis and excess deaths.mp4 | 2024-06-25 05:22 | 630M | |
| Vaccine reduces spread.mp4 | 2021-02-07 22:26 | 185M | |
| Vaccine refusal, Doctor Suneel Dhand.mp4 | 2023-03-14 04:17 | 739M | |
| Vaccine refusers hospitalised.mp4 | 2021-05-16 22:28 | 223M | |
| Vaccine review.mp4 | 2024-11-03 17:46 | 25M | |
| Vaccine risk reduction.mp4 | 2021-05-23 15:37 | 158M | |
| Vaccines, acid blockers, mouth wash and mental health.mp4 | 2020-11-30 16:21 | 234M | |
| Vaccines, excellent real world data.mp4 | 2021-02-26 02:13 | 171M | |
| Vaccines, one shot or two_.mp4 | 2021-01-02 01:20 | 286M | |
| Vaccines, third doses required.mp4 | 2021-08-20 08:21 | 258M | |
| Vaccine safety update.mp4 | 2021-04-08 19:27 | 306M | |
| Vaccines and genetics.mp4 | 2020-12-18 15:59 | 373M | |
| Vaccines and increasing infections.mp4 | 2021-10-23 05:18 | 371M | |
| Vaccines and sperm counts.mp4 | 2021-08-10 11:42 | 193M | |
| Vaccines and viral variants.mp4 | 2023-01-23 18:03 | 353M | |
| Vaccines for Children_.mp4 | 2021-06-19 02:25 | 236M | |
| Vaccines for all 5 year olds.mp4 | 2022-02-17 23:14 | 242M | |
| Vaccines from age 5_.mp4 | 2021-09-21 18:41 | 369M | |
| Vaccine side effects.mp4 | 2021-03-11 18:53 | 246M | |
| Vaccine trackers.mp4 | 2021-01-09 23:50 | 317M | |
| Vaccine trends and Long covid.mp4 | 2021-06-04 22:59 | 208M | |
| Vaccine trial whistle blower.mp4 | 2021-11-08 09:17 | 208M | |
| Variants, vaccines and syndrome.mp4 | 2020-12-26 23:45 | 286M | |
| Very rare common adverse reactions.mp4 | 2025-01-16 02:46 | 63M | |
| Village health and disease.mp4 | 2022-09-18 01:38 | 305M | |
| Viral Vaccine paper.mp4 | 2023-07-05 23:52 | 287M | |
| Viral_ The Origin of Covid 19 _ Matt Ridley _ EP 310.mp4 | 2022-12-03 14:35 | 698M | |
| Viral exposure guidelines, US and UK.mp4 | 2020-10-23 12:52 | 421M | |
| Viral load, x 1,200.mp4 | 2021-07-25 08:02 | 216M | |
| Viral mutation and evolution.mp4 | 2021-03-27 03:46 | 299M | |
| Viral mutation news.mp4 | 2020-12-21 20:43 | 63M | |
| Viral mutation update.mp4 | 2020-12-20 23:51 | 188M | |
| Viral origins, last chance saloon.mp4 | 2021-10-31 21:33 | 344M | |
| Viral origins Senate hearing.mp4 | 2024-07-28 19:21 | 65M | |
| Viral origins and dystopia.mp4 | 2023-10-11 10:02 | 537M | |
| Viral origins and personal experience.mp4 | 2021-09-07 01:37 | 298M | |
| Viral origins and vaccine supply.mp4 | 2021-01-31 15:16 | 365M | |
| Viral origins evidence.mp4 | 2024-10-22 18:20 | 77M | |
| Viral secrets.mp4 | 2022-10-02 23:10 | 146M | |
| Viral transmission not tested in Pfizer trials.mp4 | 2022-10-13 12:09 | 48M | |
| Viral vaccine paper, Dr Vibeke Manniche.mp4 | 2023-07-06 07:23 | 527M | |
| Virology in Iran.mp4 | 2021-12-31 22:40 | 430M | |
| Virus confirmed, March 2019.mp4 | 2021-06-06 14:29 | 293M | |
| Virus in Italy, September 2019.mp4 | 2021-05-02 18:18 | 195M | |
| Vit D and prostate cancer.mp4 | 2023-04-28 12:00 | 128M | |
| Vit D research, definitive and significant.mp4 | 2024-07-28 19:21 | 46M | |
| Vitamin A and mystery pneumonia.mp4 | 2024-07-28 19:22 | 401M | |
| Vitamin D, Safe and effective.mp4 | 2022-11-20 18:16 | 182M | |
| Vitamin D, Strong evidence from Israel.mp4 | 2022-03-04 23:24 | 212M | |
| Vitamin D, UK deficiencies acknowledged.mp4 | 2022-04-18 16:17 | 149M | |
| Vitamin D, a tale of two studies.mp4 | 2022-04-12 01:12 | 183M | |
| Vitamin D, blood levels.mp4 | 2021-02-14 06:35 | 330M | |
| Vitamin D, government inaction.mp4 | 2021-11-21 08:29 | 108M | |
| Vitamin D, now conclusive.mp4 | 2023-02-02 01:48 | 141M | |
| Vitamin D and diabetes.mp4 | 2023-02-11 01:09 | 147M | |
| Vitamin D deficiency in India.mp4 | 2021-04-26 16:57 | 172M | |
| Vitamin D deficiency in the UK.mp4 | 2020-12-23 23:52 | 259M | |
| Vitamin D deficiency pandemic.mp4 | 2024-07-28 19:22 | 314M | |
| Vitamin D doses.mp4 | 2023-05-15 09:59 | 160M | |
| Vitamin D in Israel.mp4 | 2021-12-11 14:48 | 346M | |
| Vitamin D levels advised.mp4 | 2021-12-18 07:30 | 422M | |
| Vitamin D reduced dementia by 40%.mp4 | 2023-03-18 22:10 | 301M | |
| Vitamin D reduces autoimmune disease.mp4 | 2022-05-30 00:10 | 187M | |
| Vitamin D reduces hospital risk.mp4 | 2021-07-06 06:37 | 146M | |
| Vitamin D studies confirm correlations.mp4 | 2021-02-06 01:21 | 267M | |
| Vitamins D and K2.mp4 | 2021-03-05 04:35 | 366M | |
| WEF and excess deaths.mp4 | 2024-07-28 19:26 | 40M | |
| WHO’s Global Digital Health Certification Network.mp4 | 2023-06-07 11:13 | 143M | |
| WHO, AZ vaccine safe and effective.mp4 | 2023-02-09 23:17 | 153M | |
| WHO, Viral origins full report.mp4 | 2021-03-31 22:48 | 318M | |
| WHO, YouTube and funding.mp4 | 2022-11-09 00:59 | 137M | |
| WHO admits excess deaths.mp4 | 2023-08-02 17:36 | 125M | |
| WHO admits excess deaths_part1_2.mp4 | 2023-08-03 08:23 | 120M | |
| WHO awaits review of Italian study into if virus could have been circulating in September 2019.mp4 | 2021-06-19 12:33 | 27M | |
| WHO covid vaccine revised roadmap.mp4 | 2023-04-01 09:20 | 107M | |
| WHO full rethink.mp4 | 2024-12-04 11:13 | 69M | |
| WHO new powers concern.mp4 | 2023-04-23 13:47 | 119M | |
| WHO secrecy.mp4 | 2024-07-28 19:29 | 438M | |
| WHO update.mp4 | 2024-07-28 19:30 | 215M | |
| WHO withdrawal opportunities.mp4 | 2025-02-08 20:14 | 126M | |
| Waning vaccine efficacy in the UK.mp4 | 2022-04-28 19:32 | 167M | |
| Wednesday update.mp4 | 2021-05-29 04:44 | 150M | |
| Wednesday video.mp4 | 2023-04-12 17:34 | 147M | |
| Weekend Update.mp4 | 2020-11-29 23:13 | 228M | |
| Weekend update, 12 - 13 December.mp4 | 2020-12-12 17:51 | 195M | |
| Welcome, new channel intro video.mp4 | 2021-04-03 14:26 | 39M | |
| Were lockdowns ineffective_.mp4 | 2022-02-05 23:34 | 134M | |
| What's REALLY In the mRNA Vaccine_ Truth Revealed!.mp4 | 2024-09-22 21:45 | 208M | |
| What are these.mp4 | 2024-07-28 19:26 | 39M | |
| When government cared for the people.mp4 | 2025-01-06 05:58 | 65M | |
| When to be exposed.mp4 | 2021-09-23 13:36 | 80M | |
| Where is herd immunity_.mp4 | 2021-10-31 21:13 | 183M | |
| Whistleblower - Embalmer Type Clots Occurring in the Living_.mp4 | 2024-07-28 19:26 | 76M | |
| White House, covid conspiracies revealed.mp4 | 2025-04-20 03:35 | 112M | |
| White clots common.mp4 | 2024-07-28 19:27 | 284M | |
| Who fact checks the fact checkers.mp4 | 2022-10-11 14:05 | 157M | |
| Why are the Vaxed still Circulating Covid_.mp4 | 2023-05-31 14:37 | 28M | |
| Winter Vitamin D Update.mp4 | 2020-11-01 02:51 | 435M | |
| Winter hospitalisations will increase.mp4 | 2021-09-20 17:03 | 288M | |
| World Council for Health expose evil.mp4 | 2023-09-07 09:30 | 121M | |
| World watching UK experiment.mp4 | 2021-07-19 22:45 | 52M | |
| Worm meds.mp4 | 2024-11-17 13:19 | 126M | |
| Worst cold ever.mp4 | 2021-09-25 09:40 | 199M | |
| Worth a Shot (vaccine injury).mp4 | 2024-12-06 09:04 | 704M | |
| XBB 1 5, expect to catch this soon.mp4 | 2023-01-12 17:57 | 170M | |
| XE recombination arrives.mp4 | 2022-04-04 17:14 | 180M | |
| YOU WERE WARNED.mp4 | 2025-01-05 16:20 | 64M | |
| Yellow card myocarditis warning.mp4 | 2022-12-21 17:01 | 181M | |
| Young excess deaths.mp4 | 2023-06-11 17:00 | 45M | |
| Your blood clot data.mp4 | 2024-09-29 22:47 | 86M | |
| Your cancer feedback.mp4 | 2025-04-01 18:30 | 122M | |
| Zero covid and smallpox.mp4 | 2024-07-28 19:31 | 111M | |
| Zinc nutrition as we enter endemic phase.mp4 | 2021-09-21 12:48 | 130M | |
| Zoe data with Professor Spector.mp4 | 2022-10-21 17:52 | 218M | |
| arterial disease.mp4 | 2024-04-30 11:57 | 73M | |
| mRNA in blood after 28 days.mp4 | 2023-02-21 23:00 | 230M | |
|
|---|